| Drug General Information |
| Drug ID |
D06XXH
|
| Former ID |
DNCL002725
|
| Drug Name |
Dacomitinib
|
| Synonyms |
PF-00299804
|
| Drug Type |
Small molecular drug
|
| Indication |
Non-small-cell lung cancer
[ICD-11: 2C25.Y; ICD-9: 162]
|
Approved |
[1] |
| Company |
Pfizer
|
| Structure |
 |
Download
2D MOL
3D MOL
|
| Formula |
C24H25ClFN5O2
|
| Canonical SMILES |
COC1=C(C=C2C(=C1)N=CN=C2NC3=CC(=C(C=C3)F)Cl)NC(=O)C=CCN4CCCCC4
|
| InChI |
1S/C24H25ClFN5O2/c1-33-22-14-20-17(24(28-15-27-20)29-16-7-8-19(26)18(25)12-16)13-21(22)30-23(32)6-5-11-31-9-3-2-4-10-31/h5-8,12-15H,2-4,9-11H2,1H3,(H,30,32)(H,27,28,29)/b6-5+
|
| InChIKey |
LVXJQMNHJWSHET-AATRIKPKSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
16613030, 23640600, 74609599, 135263265, 135626635, 136340260, 136349571, 136367702, 140977763, 152159560, 152258509, 160647344, 162011542, 162038136, 162205175, 164041746, 172918917, 174505192, 174526192, 178103994, 185997026, 189622863, 194690240, 198956821, 223382341, 223705276, 252109876, 252216044, 252451737, 252451797
|
| ChEBI ID |
CHEBI:132268
|
| Target and Pathway |
| Target(s) |
Epidermal growth factor receptor (EGFR) |
Target Info
|
Antagonist |
[2] |
| Erbb2 tyrosine kinase receptor (HER2) |
Target Info
|
Antagonist |
[3] |
| Erbb4 tyrosine kinase receptor (Erbb-4) |
Target Info
|
Antagonist |
[3] |
|
KEGG Pathway
|
ErbB signaling pathway
|
|
Calcium signaling pathway
|
|
Endocytosis
|
|
Proteoglycans in cancer
|
|
Adherens junction
|
|
Pathways in cancer
|
|
Proteoglycans in cancer
|
|
MicroRNAs in cancer
|
|
Pancreatic cancer
|
|
Endometrial cancer
|
|
Prostate cancer
|
|
Bladder cancer
|
|
Non-small cell lung cancer
|
|
Central carbon metabolism in cancer
|
|
Regulation of actin cytoskeleton
|
|
GnRH signaling pathway
|
|
Estrogen signaling pathway
|
|
Oxytocin signaling pathway
|
|
Epithelial cell signaling in Helicobacter pylori infection
|
|
Hepatitis C
|
|
Pathways in cancer
|
|
Proteoglycans in cancer
|
|
MicroRNAs in cancer
|
|
Pancreatic cancer
|
|
Endometrial cancer
|
|
Glioma
|
|
Prostate cancer
|
|
Melanoma
|
|
Bladder cancer
|
|
Non-small cell lung cancer
|
|
Central carbon metabolism in cancer
|
|
Choline metabolism in cancer
|
|
NetPath Pathway
|
TCR Signaling Pathway
|
|
EGFR1 Signaling Pathway
|
|
Panther Pathway
|
Alzheimer disease-presenilin pathway
|
|
Cadherin signaling pathway
|
|
EGF receptor signaling pathway
|
|
Pathwhiz Pathway
|
Phosphatidylinositol Phosphate Metabolism
|
|
Pathway Interaction Database
|
ErbB4 signaling events
|
|
ErbB2/ErbB3 signaling events
|
|
ErbB receptor signaling network
|
|
a6b1 and a6b4 Integrin signaling
|
|
Validated targets of C-MYC transcriptional repression
|
|
SHP2 signaling
|
|
Regulation of Telomerase
|
|
EGF receptor (ErbB1) signaling pathway
|
|
EGFR-dependent Endothelin signaling events
|
|
Posttranslational regulation of adherens junction stability and dissassembly
|
|
Direct p53 effectors
|
|
ErbB1 downstream signaling
|
|
Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling
|
|
E-cadherin signaling in keratinocytes
|
|
ErbB receptor signaling network
|
|
Internalization of ErbB1
|
|
Stabilization and expansion of the E-cadherin adherens junction
|
|
a6b1 and a6b4 Integrin signaling
|
|
Syndecan-3-mediated signaling events
|
|
Reactome
|
SHC1 events in ERBB2 signaling
|
|
PLCG1 events in ERBB2 signaling
|
|
PIP3 activates AKT signaling
|
|
GRB2 events in ERBB2 signaling
|
|
PI3K events in ERBB2 signaling
|
|
Constitutive Signaling by Aberrant PI3K in Cancer
|
|
Sema4D induced cell migration and growth-cone collapse
|
|
RAF/MAP kinase cascade
|
|
GRB2 events in ERBB2 signaling
|
|
PI3K events in ERBB2 signaling
|
|
EGFR Transactivation by Gastrin
|
|
Constitutive Signaling by Aberrant PI3K in Cancer
|
|
Constitutive Signaling by EGFRvIII
|
|
RAF/MAP kinase cascade
|
|
WikiPathways
|
ErbB Signaling Pathway
|
|
EV release from cardiac cells and their functional effects
|
|
EGF/EGFR Signaling Pathway
|
|
Focal Adhesion
|
|
Extracellular vesicle-mediated signaling in recipient cells
|
|
Bladder Cancer
|
|
Signaling by ERBB2
|
|
Integrated Pancreatic Cancer Pathway
|
|
Signaling Pathways in Glioblastoma
|
|
Leptin signaling pathway
|
|
miR-targeted genes in muscle cell - TarBase
|
|
Semaphorin interactions
|
|
Signaling by ERBB2
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
PIP3 activates AKT signaling
|
|
Nanoparticle-mediated activation of receptor signaling
|
|
Aryl Hydrocarbon Receptor
|
|
Spinal Cord Injury
|
|
Integrated Pancreatic Cancer Pathway
|
|
Gastric cancer network 2
|
|
AGE/RAGE pathway
|
|
Signaling Pathways in Glioblastoma
|
|
Arylhydrocarbon receptor (AhR) signaling pathway
|
|
miR-targeted genes in muscle cell - TarBase
|
|
miR-targeted genes in lymphocytes - TarBase
|
|
miR-targeted genes in epithelium - TarBase
|
|
Integrated Breast Cancer Pathway
|
|
Signaling by EGFR
|
|
L1CAM interactions
|
| References |
| REF 1 |
2018 FDA drug approvals.Nat Rev Drug Discov. 2019 Feb;18(2):85-89.
|
| REF 2 |
URL: http://www.guidetopharmacology.org Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Target id: 1797).
|
| REF 3 |
URL: http://www.guidetopharmacology.org Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 7422).
|
