| Drug General Information |
| Drug ID |
D02XHC
|
| Former ID |
DIB018806
|
| Drug Name |
aloisine A
|
| Synonyms |
RP107
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C16H17N3O
|
| InChI |
InChI=1S/C16H17N3O/c1-2-3-4-13-14(11-5-7-12(20)8-6-11)19-16-15(13)17-9-10-18-16/h5-10,17H,2-4H2,1H3,(H,18,19)
|
| InChIKey |
AYIIQABSVDIZSY-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
584363, 7626329, 7885843, 11108168, 12015724, 14720331, 15021228, 26758198, 34951427, 39299607, 46393319, 47275523, 53800979, 57361260, 71750027, 77952348, 85787184, 91610407, 99217510, 99302620, 99374240, 99443835, 103024430, 103277014, 109693172, 113905292, 126579265, 126634877, 126726481, 134341079, 135703275, 136890894, 137389439, 160968447, 163108982, 163688630, 164224746, 164835225, 165237888, 172888210, 175607454, 178102547, 179230458, 184600766, 202546269, 204380522, 208265185, 223548302, 226459201, 241084787
|
| Target and Pathway |
| Target(s) |
mRNA of human glycogen synthase kinase 3 alpha |
Target Info |
Inhibitor |
[1]
|
|---|
| Cell division control protein 2 homolog |
Target Info |
Inhibitor |
[1]
|
| Cell division protein kinase 2 |
Target Info |
Inhibitor |
[1]
|
| Cell division protein kinase 5 |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
Chemokine signaling pathway
|
|
Dopaminergic synapse
|
|
Non-alcoholic fatty liver disease (NAFLD)hsa04110:Cell cycle
|
|
Oocyte meiosis
|
|
p53 signaling pathway
|
|
Gap junction
|
|
Progesterone-mediated oocyte maturation
|
|
Herpes simplex infection
|
|
Epstein-Barr virus infection
|
|
Viral carcinogenesishsa04068:FoxO signaling pathway
|
|
Cell cycle
|
|
PI3K-Akt signaling pathway
|
|
Hepatitis B
|
|
Measles
|
|
Pathways in cancer
|
|
Viral carcinogenesis
|
|
Prostate cancer
|
|
Small cell lung cancerhsa04360:Axon guidance
|
|
Alzheimer's disease
|
|
Cocaine addiction
|
|
NetPath Pathway
|
TGF_beta_Receptor Signaling PathwayNetPath_21:RANKL Signaling PathwayNetPath_11:TCR Signaling PathwayNetPath_4:EGFR1 Signaling Pathway
|
|
TCR Signaling Pathway
|
|
PANTHER Pathway
|
Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Insulin/IGF pathway-protein kinase B signaling cascade
|
|
PDGF signaling pathway
|
|
Ras PathwayP00059:p53 pathway
|
|
p53 pathway feedback loops 2P00007:Axon guidance mediated by semaphorins
|
|
Pathway Interaction Database
|
Degradation of beta catenin
|
|
Canonical Wnt signaling pathway
|
|
FOXM1 transcription factor network
|
|
Class I PI3K signaling events mediated by Aktp73pathway:p73 transcription factor network
|
|
E2F transcription factor network
|
|
PLK1 signaling events
|
|
AP-1 transcription factor network
|
|
Retinoic acid receptors-mediated signalingsmad2_3nuclearpathway:Regulation of nuclear SMAD2/3 signaling
|
|
Signaling events mediated by PRL
|
|
p73 transcription factor network
|
|
ATR signaling pathway
|
|
mTOR signaling pathway
|
|
IL2-mediated signaling events
|
|
FoxO family signaling
|
|
BARD1 signaling events
|
|
p53 pathway
|
|
Regulation of retinoblastoma proteinreelinpathway:Reelin signaling pathway
|
|
Glucocorticoid receptor regulatory network
|
|
Lissencephaly gene (LIS1) in neuronal migration and development
|
|
EPHA forward signaling
|
|
Trk receptor signaling mediated by the MAPK pathway
|
|
Reactome
|
AKT phosphorylates targets in the cytosol
|
|
XBP1(S) activates chaperone genes
|
|
Constitutive Signaling by AKT1 E17K in CancerR-HSA-110056:MAPK3 (ERK1) activation
|
|
E2F mediated regulation of DNA replication
|
|
G0 and Early G1
|
|
Cyclin B2 mediated events
|
|
Golgi Cisternae Pericentriolar Stack Reorganization
|
|
Cdc20:Phospho-APC/C mediated degradation of Cyclin A
|
|
Regulation of APC/C activators between G1/S and early anaphase
|
|
Phosphorylation of the APC/C
|
|
Phosphorylation of Emi1
|
|
Condensation of Prophase Chromosomes
|
|
MASTL Facilitates Mitotic Progression
|
|
Resolution of Sister Chromatid Cohesion
|
|
Condensation of Prometaphase Chromosomes
|
|
Regulation of PLK1 Activity at G2/M Transition
|
|
Activation of NIMA Kinases NEK9, NEK6, NEK7
|
|
Loss of Nlp from mitotic centrosomes
|
|
Recruitment of mitotic centrosome proteins and complexes
|
|
Loss of proteins required for interphase microtubule organization?from the centrosome
|
|
Recruitment of NuMA to mitotic centrosomes
|
|
Depolymerisation of the Nuclear Lamina
|
|
Anchoring of the basal body to the plasma membrane
|
|
MAPK6/MAPK4 signaling
|
|
G1/S-Specific Transcription
|
|
Cyclin A/B1 associated events during G2/M transition
|
|
G2/M DNA replication checkpoint
|
|
Chk1/Chk2(Cds1) mediated inactivation of Cyclin B:Cdk1 complexR-HSA-1538133:G0 and Early G1
|
|
Activation of ATR in response to replication stress
|
|
SCF(Skp2)-mediated degradation of p27/p21
|
|
Senescence-Associated Secretory Phenotype (SASP)
|
|
DNA Damage/Telomere Stress Induced Senescence
|
|
Processing of DNA double-strand break ends
|
|
G2 Phase
|
|
Orc1 removal from chromatin
|
|
Cyclin E associated events during G1/S transition
|
|
p53-Dependent G1 DNA Damage Response
|
|
Cyclin A:Cdk2-associated events at S phase entry
|
|
Meiotic recombination
|
|
Factors involved in megakaryocyte development and platelet productionR-HSA-180024:DARPP-32 events
|
|
CRMPs in Sema3A signaling
|
|
Factors involved in megakaryocyte development and platelet production
|
|
WikiPathways
|
Glycogen Metabolism
|
|
Insulin Signaling
|
|
Wnt Signaling Pathway Netpath
|
|
Activation of Chaperone Genes by XBP1(S)
|
|
T-Cell Receptor and Co-stimulatory Signaling
|
|
Integrated Pancreatic Cancer Pathway
|
|
B Cell Receptor Signaling Pathway
|
|
Leptin signaling pathway
|
|
Integrated Breast Cancer Pathway
|
|
SREBP signalling
|
|
IL-5 Signaling PathwayWP707:DNA Damage Response
|
|
G1 to S cell cycle control
|
|
TGF beta Signaling Pathway
|
|
PPAR Alpha Pathway
|
|
MAP kinase activation in TLR cascade
|
|
RAF/MAP kinase cascade
|
|
Mitotic Prophase
|
|
Mitotic Prometaphase
|
|
BMI1
|
|
ATM Signaling Pathway
|
|
Retinoblastoma (RB) in Cancer
|
|
Spinal Cord Injury
|
|
Prostate Cancer
|
|
Regulation of Microtubule Cytoskeleton
|
|
Integrated Cancer pathway
|
|
Mitotic G2-G2/M phases
|
|
Mitotic G1-G1/S phases
|
|
Cell Cycle
|
|
APC/C-mediated degradation of cell cycle proteins
|
|
Cell Cycle Checkpoints
|
|
miRNA Regulation of DNA Damage ResponseWP707:DNA Damage Response
|
|
ID signaling pathway
|
|
DNA Replication
|
|
M/G1 Transition
|
|
S Phase
|
|
Meiotic Recombination
|
|
Aryl Hydrocarbon Receptor
|
|
Oncostatin M Signaling Pathway
|
|
Signaling Pathways in Glioblastoma
|
|
TSH signaling pathway
|
|
Synthesis of DNA
|
|
Regulation of DNA replication
|
|
Factors involved in megakaryocyte development and platelet production
|
|
BDNF signaling pathway
|
|
Alzheimers Disease
|
|
Opioid Signalling
|
|
Semaphorin interactions
|
|
Nicotine Activity on Dopaminergic Neurons
|
|
miRNA Regulation of DNA Damage Response
|
| References |
| REF 1 | J Med Chem. 2003 Jan 16;46(2):222-36.Aloisines, a new family of CDK/GSK-3 inhibitors. SAR study, crystal structure in complex with CDK2, enzyme selectivity, and cellular effects. |
|---|
