| Drug General Information |
| Drug ID |
D05KQC
|
| Former ID |
DNC011731
|
| Drug Name |
DNQX
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C8H4N4O6
|
| Canonical SMILES |
C1=C2C(=CC(=C1[N+](=O)[O-])[N+](=O)[O-])NC(=O)C(=O)N2
|
| InChI |
1S/C8H4N4O6/c13-7-8(14)10-4-2-6(12(17)18)5(11(15)16)1-3(4)9-7/h1-2H,(H,9,13)(H,10,14)
|
| InChIKey |
RWVIMCIPOAXUDG-UHFFFAOYSA-N
|
| CAS Number |
CAS 2379-57-9
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Glutamate receptor 1 |
Target Info |
Inhibitor |
[2]
|
|---|
| Glutamate receptor, ionotropic kainate 1 |
Target Info |
Inhibitor |
[2]
|
| Glutamate [NMDA] receptor subunit epsilon 2 |
Target Info |
Inhibitor |
[1]
|
| Glutamate receptor AMPA subtype |
Target Info |
Inhibitor |
[2]
|
| Glutamate [NMDA] receptor subunit epsilon 1 |
Target Info |
Inhibitor |
[1]
|
| NMDA receptor subunit NR1 |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
cAMP signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
Circadian entrainment
|
|
Long-term potentiation
|
|
Retrograde endocannabinoid signaling
|
|
Glutamatergic synapse
|
|
Dopaminergic synapse
|
|
Long-term depression
|
|
Amyotrophic lateral sclerosis (ALS)
|
|
Amphetamine addiction
|
|
Nicotine addictionhsa04080:Neuroactive ligand-receptor interaction
|
|
Glutamatergic synapsehsa04014:Ras signaling pathway
|
|
Rap1 signaling pathway
|
|
Alzheimer's disease
|
|
Huntington's disease
|
|
Cocaine addiction
|
|
Nicotine addiction
|
|
Alcoholism
|
|
Systemic lupus erythematosushsa04014:Ras signaling pathway
|
|
Calcium signaling pathway
|
|
PANTHER Pathway
|
Ionotropic glutamate receptor pathway
|
|
Metabotropic glutamate receptor group III pathwayP00029:Huntington disease
|
|
Metabotropic glutamate receptor group III pathway
|
|
Metabotropic glutamate receptor group I pathwayP00029:Huntington disease
|
|
Metabotropic glutamate receptor group I pathway
|
|
Muscarinic acetylcholine receptor 1 and 3 signaling pathwayP00029:Huntington disease
|
|
Muscarinic acetylcholine receptor 1 and 3 signaling pathway
|
|
Pathway Interaction Database
|
EPHB forward signalingerbb4_pathway:ErbB4 signaling events
|
|
Reelin signaling pathwayreelinpathway:Reelin signaling pathway
|
|
Reactome
|
COPII (Coat Protein 2) Mediated Vesicle Transport
|
|
Trafficking of AMPA receptors
|
|
Trafficking of GluR2-containing AMPA receptors
|
|
Unblocking of NMDA receptor, glutamate binding and activation
|
|
Cargo concentration in the ERR-HSA-3928662:EPHB-mediated forward signaling
|
|
CREB phosphorylation through the activation of CaMKII
|
|
Ras activation uopn Ca2+ infux through NMDA receptor
|
|
RAF/MAP kinase cascadeR-HSA-438066:Unblocking of NMDA receptor, glutamate binding and activation
|
|
RAF/MAP kinase cascadeR-HSA-3928662:EPHB-mediated forward signaling
|
|
RAF/MAP kinase cascade
|
|
WikiPathways
|
Hypothetical Network for Drug Addiction
|
|
Neurotransmitter Receptor Binding And Downstream Transmission In The Postsynaptic Cell
|
|
Amyotrophic lateral sclerosis (ALS)
|
|
BDNF signaling pathwayWP2754:Neurotransmitter Receptor Binding And Downstream Transmission In The Postsynaptic CellWP666:Hypothetical Network for Drug Addiction
|
|
BDNF signaling pathwayWP666:Hypothetical Network for Drug Addiction
|
|
Alzheimers DiseaseWP706:SIDS Susceptibility Pathways
|
|
Spinal Cord Injury
|
|
BDNF signaling pathway
|
|
Alzheimers Disease
|
| References |
| REF 1 | J Med Chem. 1991 Apr;34(4):1243-52.Kynurenic acid derivatives. Structure-activity relationships for excitatory amino acid antagonism and identification of potent and selective antagonists at the glycine site on the N-methyl-D-aspartate receptor. |
|---|
| REF 2 | J Med Chem. 1996 Oct 25;39(22):4430-8.Synthesis of chiral 1-(2'-amino-2'-carboxyethyl)-1,4-dihydro-6,7-quinoxaline-2,3-diones: alpha-amino-3-hydroxy-5-methyl-4-isoxazolepropionate receptor agonists and antagonists. |
|---|
