| Drug General Information |
| Drug ID |
D0J7DI
|
| Former ID |
DIB009319
|
| Drug Name |
KAI-1455
|
| Drug Type |
Small molecular drug
|
| Indication |
Ischemic reperfusion injury [ICD10:I00-I99]
|
Discontinued in Phase 1 |
[1]
|
|---|
| Company |
KAI Pharmaceuticals
|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C9H18N2O4
|
| Canonical SMILES |
CCCC(C)(COC(=O)N)COC(=O)N
|
| InChI |
1S/C9H18N2O4/c1-3-4-9(2,5-14-7(10)12)6-15-8(11)13/h3-6H2,1-2H3,(H2,10,12)(H2,11,13)
|
| InChIKey |
NPPQSCRMBWNHMW-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
89640, 7366092, 7847442, 7979904, 8152550, 10527934, 14822610, 17389535, 24896728, 29223175, 46508142, 48416220, 48425274, 50021624, 50893943, 57654362, 68530538, 87245066, 103255535, 104305326, 108165187, 117425357, 124890349, 125353471, 126677741, 128736426, 134222669, 134337962, 134338694, 134338822, 134971019, 136949641, 137001618, 142043533, 144204614, 144207530, 144238911, 160963718, 164827462, 175268791, 176254515, 177513105, 178103799, 179225303, 184532185, 198991699, 223674399, 226405717, 249946527, 252403288
|
| Target and Pathway |
| Target(s) |
Protein kinase C, epsilon type |
Target Info |
Stimulator |
[2]
|
|---|
|
KEGG Pathway
|
cGMP-PKG signaling pathway
|
|
Sphingolipid signaling pathway
|
|
Vascular smooth muscle contraction
|
|
Tight junction
|
|
Fc epsilon RI signaling pathway
|
|
Fc gamma R-mediated phagocytosis
|
|
Inflammatory mediator regulation of TRP channels
|
|
Type II diabetes mellitus
|
|
MicroRNAs in cancer
|
|
NetPath Pathway
|
IL2 Signaling Pathway
|
|
PANTHER Pathway
|
Alpha adrenergic receptor signaling pathway
|
|
Alzheimer disease-amyloid secretase pathway
|
|
Angiogenesis
|
|
Apoptosis signaling pathway
|
|
EGF receptor signaling pathway
|
|
Endothelin signaling pathway
|
|
FGF signaling pathway
|
|
Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathway
|
|
Inflammation mediated by chemokine and cytokine signaling pathway
|
|
Muscarinic acetylcholine receptor 1 and 3 signaling pathway
|
|
VEGF signaling pathway
|
|
Wnt signaling pathway
|
|
5HT2 type receptor mediated signaling pathway
|
|
Histamine H1 receptor mediated signaling pathway
|
|
Oxytocin receptor mediated signaling pathway
|
|
Thyrotropin-releasing hormone receptor signaling pathway
|
|
CCKR signaling map ST
|
|
Pathway Interaction Database
|
Endothelins
|
|
LPA receptor mediated events
|
|
TCR signaling in naï
|
|
LPA4-mediated signaling events
|
|
CDC42 signaling events
|
|
TCR signaling in naï
|
|
Thromboxane A2 receptor signaling
|
|
Role of Calcineurin-dependent NFAT signaling in lymphocytes
|
|
IL2-mediated signaling events
|
|
PDGFR-beta signaling pathway
|
|
IL8- and CXCR1-mediated signaling events
|
|
Regulation of Ras family activation
|
|
Downstream signaling in naï
|
|
Reactome
|
Effects of PIP2 hydrolysis
|
|
DAG and IP3 signaling
|
|
Role of phospholipids in phagocytosis
|
|
G alpha (z) signalling events
|
|
WikiPathways
|
Hypothetical Network for Drug Addiction
|
|
Calcium Regulation in the Cardiac Cell
|
|
Wnt Signaling Pathway
|
|
Wnt Signaling Pathway and Pluripotency
|
|
G Protein Signaling Pathways
|
|
Myometrial Relaxation and Contraction Pathways
|
|
Oncostatin M Signaling Pathway
|
|
miRs in Muscle Cell Differentiation
|
|
GPCR downstream signaling
|
|
Effects of PIP2 hydrolysis
|
|
Physiological and Pathological Hypertrophy of the Heart
|
| References |
| REF 1 | Trusted, scientifically sound profiles of drug programs, clinical trials, safety reports, and company deals, written by scientists. Springer. 2015. Adis Insight (drug id 800026294) |
|---|
| REF 2 | Protein kinase C, an elusive therapeutic target?. Nat Rev Drug Discov. 2012 December; 11(12): 937-957. |
|---|
