| Drug General Information |
| Drug ID |
D0K1DR
|
| Former ID |
DNC010639
|
| Drug Name |
LEUCETTAMINE B
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C12H11N3O3
|
| Canonical SMILES |
CN1C(=O)C(=CC2=CC3=C(C=C2)OCO3)N=C1N
|
| InChI |
1S/C12H11N3O3/c1-15-11(16)8(14-12(15)13)4-7-2-3-9-10(5-7)18-6-17-9/h2-5H,6H2,1H3,(H2,13,14)/b8-4-
|
| InChIKey |
PKEDBIGNILOTHW-YWEYNIOJSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Glycogen synthase kinase-3 beta |
Target Info |
Inhibitor |
[1]
|
|---|
| mRNA of human glycogen synthase kinase 3 alpha |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
ErbB signaling pathway
|
|
Chemokine signaling pathway
|
|
Cell cycle
|
|
PI3K-Akt signaling pathway
|
|
Wnt signaling pathway
|
|
Hedgehog signaling pathway
|
|
Axon guidance
|
|
Hippo signaling pathway
|
|
Focal adhesion
|
|
Signaling pathways regulating pluripotency of stem cells
|
|
T cell receptor signaling pathway
|
|
B cell receptor signaling pathway
|
|
Neurotrophin signaling pathway
|
|
Dopaminergic synapse
|
|
Insulin signaling pathway
|
|
Melanogenesis
|
|
Prolactin signaling pathway
|
|
Thyroid hormone signaling pathway
|
|
Non-alcoholic fatty liver disease (NAFLD)
|
|
Alzheimer's disease
|
|
Hepatitis C
|
|
Measles
|
|
Influenza A
|
|
HTLV-I infection
|
|
Epstein-Barr virus infection
|
|
Pathways in cancer
|
|
Colorectal cancer
|
|
Endometrial cancer
|
|
Prostate cancer
|
|
Basal cell carcinomahsa04062:Chemokine signaling pathway
|
|
NetPath Pathway
|
TGF_beta_Receptor Signaling Pathway
|
|
PANTHER Pathway
|
Alzheimer disease-presenilin pathway
|
|
Angiogenesis
|
|
Cadherin signaling pathway
|
|
Hedgehog signaling pathway
|
|
Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Insulin/IGF pathway-protein kinase B signaling cascade
|
|
Interleukin signaling pathway
|
|
PDGF signaling pathway
|
|
PI3 kinase pathway
|
|
Wnt signaling pathway
|
|
Ras Pathway
|
|
CCKR signaling map STP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Pathway Interaction Database
|
LPA receptor mediated events
|
|
Degradation of beta catenin
|
|
Reelin signaling pathway
|
|
Presenilin action in Notch and Wnt signaling
|
|
Integrin-linked kinase signaling
|
|
CDC42 signaling events
|
|
LKB1 signaling events
|
|
Canonical Wnt signaling pathway
|
|
Role of Calcineurin-dependent NFAT signaling in lymphocytes
|
|
Glucocorticoid receptor regulatory network
|
|
C-MYC pathway
|
|
Regulation of Androgen receptor activity
|
|
BMP receptor signaling
|
|
Hedgehog signaling events mediated by Gli proteins
|
|
Signaling events mediated by Stem cell factor receptor (c-Kit)
|
|
Validated transcriptional targets of deltaNp63 isoforms
|
|
Aurora A signaling
|
|
Insulin-mediated glucose transport
|
|
Class I PI3K signaling events mediated by Akt
|
|
p53 pathway
|
|
Trk receptor signaling mediated by PI3K and PLC-gammabetacatenin_deg_pathway:Degradation of beta catenin
|
|
FOXM1 transcription factor network
|
|
Reactome
|
Degradation of beta-catenin by the destruction complex
|
|
AKT phosphorylates targets in the cytosol
|
|
Regulation of HSF1-mediated heat shock response
|
|
CRMPs in Sema3A signaling
|
|
Disassembly of the destruction complex and recruitment of AXIN to the membrane
|
|
S33 mutants of beta-catenin aren't phosphorylated
|
|
S37 mutants of beta-catenin aren't phosphorylated
|
|
S45 mutants of beta-catenin aren't phosphorylated
|
|
T41 mutants of beta-catenin aren't phosphorylated
|
|
Degradation of GLI2 by the proteasome
|
|
Constitutive Signaling by AKT1 E17K in CancerR-HSA-198323:AKT phosphorylates targets in the cytosol
|
|
XBP1(S) activates chaperone genes
|
|
Constitutive Signaling by AKT1 E17K in Cancer
|
|
WikiPathways
|
DNA Damage Response (only ATM dependent)
|
|
Senescence and Autophagy in Cancer
|
|
Notch Signaling Pathway
|
|
Glycogen Metabolism
|
|
Insulin Signaling
|
|
Wnt Signaling Pathway
|
|
Wnt Signaling Pathway and Pluripotency
|
|
IL-6 signaling pathway
|
|
Wnt Signaling Pathway Netpath
|
|
Copper homeostasis
|
|
Focal Adhesion
|
|
Hair Follicle Development: Induction (Part 1 of 3)
|
|
Cardiac Hypertrophic Response
|
|
Degradation of beta-catenin by the destruction complex
|
|
T-Cell Receptor and Co-stimulatory Signaling
|
|
Cardiac Progenitor Differentiation
|
|
BDNF signaling pathway
|
|
Corticotropin-releasing hormone
|
|
B Cell Receptor Signaling Pathway
|
|
IL17 signaling pathway
|
|
Neural Crest Differentiation
|
|
Alzheimers Disease
|
|
IL-7 Signaling Pathway
|
|
Regulation of Microtubule Cytoskeleton
|
|
TWEAK Signaling Pathway
|
|
Leptin signaling pathway
|
|
Semaphorin interactions
|
|
Cell Cycle
|
|
MicroRNAs in cardiomyocyte hypertrophy
|
|
Androgen receptor signaling pathway
|
|
IL-5 Signaling PathwayWP500:Glycogen Metabolism
|
|
Activation of Chaperone Genes by XBP1(S)
|
|
Integrated Pancreatic Cancer Pathway
|
|
Integrated Breast Cancer Pathway
|
|
SREBP signalling
|
|
IL-5 Signaling Pathway
|
| References |
| REF 1 | Eur J Med Chem. 2010 Feb;45(2):805-10. Epub 2009 Oct 12.Synthesis and preliminary biological evaluation of new derivatives of the marine alkaloid leucettamine B as kinase inhibitors. |
|---|
