| Drug General Information |
| Drug ID |
D0X2NO
|
| Former ID |
DIB018062
|
| Drug Name |
(+)-ADTN
|
| Synonyms |
(+)-ADTN (aminotetralin-6,7-diol)
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
|
| Formula |
C10H13NO2
|
| InChI |
InChI=1S/C10H13NO2/c11-8-2-1-6-4-9(12)10(13)5-7(6)3-8/h4-5,8,12-13H,1-3,11H2
|
| InChIKey |
ASXGAOFCKGHGMF-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
4396597, 8152008, 11364921, 11367483, 11370045, 11373084, 11375645, 11378215, 15017255, 24714865, 26755674, 26755675, 29222295, 47365320, 47440382, 47515425, 47515426, 47662414, 47736607, 48035255, 48035256, 48185101, 50064875, 50111036, 50111037, 52533724, 57321638, 85208928, 90340878, 92310038, 99300950, 103197355, 103805117, 103925217, 104302678, 117616121, 124749696, 124879796, 124879797, 124879798, 124879799, 125570003, 126686686, 127454619, 132611435, 135072376, 135649897, 162866432, 163667276, 163882663
|
| Target and Pathway |
| Target(s) |
Dopamine D1 receptor |
Target Info |
Agonist |
[2]
|
|---|
| D(1B) dopamine receptor |
Target Info |
Agonist |
[2]
|
|
KEGG Pathway
|
Calcium signaling pathway
|
|
cAMP signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
Gap junction
|
|
Dopaminergic synapse
|
|
Parkinson's disease
|
|
Cocaine addiction
|
|
Amphetamine addiction
|
|
Morphine addiction
|
|
Alcoholismhsa04020:Calcium signaling pathway
|
|
PANTHER Pathway
|
Dopamine receptor mediated signaling pathwayP05912:Dopamine receptor mediated signaling pathway
|
|
PathWhiz Pathway
|
Dopamine Activation of Neurological Reward System
|
|
Reactome
|
Dopamine receptors
|
|
G alpha (s) signalling eventsR-HSA-390651:Dopamine receptors
|
|
G alpha (s) signalling events
|
|
WikiPathways
|
Hypothetical Network for Drug Addiction
|
|
Monoamine GPCRs
|
|
GPCRs, Class A Rhodopsin-like
|
|
Genes and (Common) Pathways Underlying Drug Addiction
|
|
GPCR ligand binding
|
|
GPCR downstream signalingWP58:Monoamine GPCRs
|
|
GPCR downstream signaling
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 932). |
|---|
| REF 2 | Cloning of the gene for a human dopamine D5 receptor with higher affinity for dopamine than D1. Nature. 1991 Apr 18;350(6319):614-9. |
|---|
