| Drug General Information |
| Drug ID |
DXT97U
|
| Drug Name |
(E)-3-(5-((E)-3-(2,5-Dichlorophenyl)-3-oxoprop-1-enyl)-furan-2-yl)-N-hydroxyacrylamide
|
| Synonyms |
CHEMBL471494
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Formula |
C16H11Cl2NO4
|
| Canonical SMILES |
ONC(=O)\\C=C\\c1oc(\\C=C\\C(=O)c2cc(Cl)ccc2Cl)cc1
|
| InChI |
InChI=1S/C16H11Cl2NO4/c17-10-1-6-14(18)13(9-10)15(20)7-4-11-2-3-12(23-11)5-8-16(21)19-22/h1-9,22H,(H,19,21)/b7-4+,8-5+
|
| InChIKey |
KARALHKIYYSJRK-NSLJXJERSA-N
|
| Target and Pathway |
| Target(s) |
Histone deacetylase 1 |
Target Info |
|
[1]
|
|---|
| Histone deacetylase 4 |
Target Info |
|
[1]
|
|
KEGG Pathway
|
Cell cycle
|
|
Notch signaling pathway
|
|
Thyroid hormone signaling pathway
|
|
Huntington's disease
|
|
Amphetamine addiction
|
|
Alcoholism
|
|
Epstein-Barr virus infection
|
|
Pathways in cancer
|
|
Transcriptional misregulation in cancer
|
|
Viral carcinogenesis
|
|
MicroRNAs in cancer
|
|
Chronic myeloid leukemiahsa05034:Alcoholism
|
|
NetPath Pathway
|
TCR Signaling PathwayNetPath_14:IL2 Signaling Pathway
|
|
PANTHER Pathway
|
Wnt signaling pathway
|
|
p53 pathway
|
|
Pathway Interaction Database
|
Regulation of nuclear SMAD2/3 signaling
|
|
Notch signaling pathway
|
|
E2F transcription factor network
|
|
Presenilin action in Notch and Wnt signaling
|
|
Signaling events mediated by HDAC Class I
|
|
Regulation of Telomerase
|
|
Glucocorticoid receptor regulatory network
|
|
Sumoylation by RanBP2 regulates transcriptional repression
|
|
Regulation of Androgen receptor activity
|
|
IL3-mediated signaling events
|
|
Validated nuclear estrogen receptor alpha network
|
|
Retinoic acid receptors-mediated signaling
|
|
Hedgehog signaling events mediated by Gli proteins
|
|
Regulation of nuclear beta catenin signaling and target gene transcription
|
|
Validated targets of C-MYC transcriptional repression
|
|
Regulation of retinoblastoma protein
|
|
Notch-mediated HES/HEY networkhdac_classii_pathway:Signaling events mediated by HDAC Class II
|
|
Signaling events mediated by HDAC Class III
|
|
Reactome
|
G0 and Early G1
|
|
p75NTR negatively regulates cell cycle via SC1
|
|
Formation of the beta-catenin:TCF transactivating complex
|
|
NOTCH1 Intracellular Domain Regulates Transcription
|
|
SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription
|
|
Constitutive Signaling by NOTCH1 PEST Domain Mutants
|
|
Constitutive Signaling by NOTCH1 HD+PEST Domain Mutants
|
|
HDACs deacetylate histones
|
|
Deactivation of the beta-catenin transactivating complex
|
|
NoRC negatively regulates rRNA expression
|
|
RNA Polymerase I Transcription Initiation
|
|
Factors involved in megakaryocyte development and platelet productionR-HSA-2122947:NOTCH1 Intracellular Domain Regulates Transcription
|
|
WikiPathways
|
SIDS Susceptibility Pathways
|
|
Notch Signaling Pathway
|
|
TGF beta Signaling Pathway
|
|
IL-6 signaling pathway
|
|
Apoptosis-related network due to altered Notch3 in ovarian cancer
|
|
Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer
|
|
Notch Signaling Pathway
|
|
Retinoblastoma (RB) in Cancer
|
|
Neural Crest Differentiation
|
|
TWEAK Signaling Pathway
|
|
Integrated Breast Cancer Pathway
|
|
Signalling by NGF
|
|
RNA Polymerase I, RNA Polymerase III, and Mitochondrial Transcription
|
|
Mitotic G1-G1/S phases
|
|
Factors involved in megakaryocyte development and platelet production
|
|
Cell Cycle
|
|
Androgen receptor signaling pathwayWP474:Endochondral Ossification
|
|
Cardiac Hypertrophic Response
|
|
miR-targeted genes in muscle cell - TarBase
|
|
miR-targeted genes in lymphocytes - TarBase
|
|
miR-targeted genes in epithelium - TarBase
|
|
TarBasePathway
|
|
MicroRNAs in cardiomyocyte hypertrophy
|
| References |
| REF 1 | URL: https://www.ebi.ac.uk/chembl/ The ChEMBL database in 2017 |
|---|
