| Drug General Information |
| Drug ID |
DX4DBL
|
| Drug Name |
(R)-3-(4-Methoxy-benzenesulfonyl)-2-methyl-propane-1-thiol
|
| Synonyms |
CHEMBL368079
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Formula |
C11H16O3S2
|
| Canonical SMILES |
COc1ccc(cc1)S(=O)(=O)C[C@H](C)CS
|
| InChI |
InChI=1S/C11H16O3S2/c1-9(7-15)8-16(12,13)11-5-3-10(14-2)4-6-11/h3-6,9,15H,7-8H2,1-2H3/t9-/m1/s1
|
| InChIKey |
QGVCPEQAAKTMNX-SECBINFHSA-N
|
| Target and Pathway |
| Target(s) |
Collagenase 3 |
Target Info |
|
[1]
|
|---|
| Interstitial collagenase |
Target Info |
|
[1]
|
|
KEGG Pathway
|
PPAR signaling pathway
|
|
Pathways in cancer
|
|
Bladder cancer
|
|
Rheumatoid arthritis
|
|
NetPath Pathway
|
IL1 Signaling PathwayNetPath_13:IL1 Signaling Pathway
|
|
EGFR1 Signaling Pathway
|
|
TWEAK Signaling Pathway
|
|
Wnt Signaling Pathway
|
|
PANTHER Pathway
|
Alzheimer disease-presenilin pathway
|
|
Plasminogen activating cascadeP00004:Alzheimer disease-presenilin pathway
|
|
Plasminogen activating cascade
|
|
Pathway Interaction Database
|
Urokinase-type plasminogen activator (uPA) and uPAR-mediated signalingendothelinpathway:Endothelins
|
|
Validated transcriptional targets of AP1 family members Fra1 and Fra2
|
|
Glucocorticoid receptor regulatory network
|
|
AP-1 transcription factor network
|
|
Syndecan-1-mediated signaling events
|
|
Reactome
|
Collagen degradation
|
|
Degradation of the extracellular matrix
|
|
Activation of Matrix Metalloproteinases
|
|
Assembly of collagen fibrils and other multimeric structuresR-HSA-1442490:Collagen degradation
|
|
Basigin interactions
|
|
Regulation of Insulin-like Growth Factor (IGF) transport and uptake by Insulin-like Growth Factor Binding Proteins (IGFBPs)
|
|
WikiPathways
|
Endochondral Ossification
|
|
Activation of Matrix Metalloproteinases
|
|
Oncostatin M Signaling Pathway
|
|
AGE/RAGE pathway
|
|
Matrix MetalloproteinasesWP366:TGF beta Signaling Pathway
|
|
Bladder Cancer
|
|
Degradation of collagen
|
|
Quercetin and Nf-kB/ AP-1 Induced Cell Apoptosis
|
|
Prostate Cancer
|
|
Integrated Breast Cancer Pathway
|
|
Integrated Cancer pathway
|
|
Cell surface interactions at the vascular wall
|
|
Matrix Metalloproteinases
|
| References |
| REF 1 | URL: https://www.ebi.ac.uk/chembl/ The ChEMBL database in 2017 |
|---|
