| Drug General Information |
| Drug ID |
D0G9IP
|
| Former ID |
DIB019809
|
| Drug Name |
eicosatetranoic acid
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
|
| Formula |
C20H24O2
|
| InChI |
InChI=1S/C20H24O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-5,8,11,14,17-19H2,1H3,(H,21,22)
|
| InChIKey |
MGLDCXPLYOWQRP-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
855627, 5171926, 8151277, 11120031, 11120519, 11121007, 11121514, 11121994, 11147114, 11362583, 11365145, 11367707, 11370437, 11370438, 11373308, 11375869, 14710747, 14775943, 24894432, 26514066, 26751462, 26751463, 26751464, 26759052, 29220980, 47290886, 47439986, 47439987, 47736207, 50100849, 51829103, 53788512, 57321019, 85085776, 87219207, 92309865, 99300779, 99302297, 103034376, 103638104, 103826410, 104046504, 104298701, 117548384, 124883345, 124883346, 124883347, 124883348, 124883349, 125334850
|
| Target and Pathway |
| Target(s) |
Peroxisome proliferator activated receptor alpha |
Target Info |
Agonist |
[2]
|
|---|
|
KEGG Pathway
|
PPAR signaling pathway
|
|
cAMP signaling pathway
|
|
Adipocytokine signaling pathway
|
|
Glucagon signaling pathway
|
|
Non-alcoholic fatty liver disease (NAFLD)
|
|
Hepatitis C
|
|
Pathway Interaction Database
|
RXR and RAR heterodimerization with other nuclear receptor
|
|
Reactome
|
RORA activates gene expression
|
|
BMAL1:CLOCK,NPAS2 activates circadian gene expression
|
|
PPARA activates gene expression
|
|
YAP1- and WWTR1 (TAZ)-stimulated gene expression
|
|
Transcriptional activation of mitochondrial biogenesis
|
|
Activation of gene expression by SREBF (SREBP)
|
|
Transcriptional regulation of white adipocyte differentiation
|
|
Nuclear Receptor transcription pathway
|
|
Regulation of lipid metabolism by Peroxisome proliferator-activated receptor alpha (PPARalpha)
|
|
Circadian Clock
|
|
WikiPathways
|
Nuclear Receptors in Lipid Metabolism and Toxicity
|
|
Nuclear Receptors Meta-Pathway
|
|
Estrogen Receptor Pathway
|
|
PPAR Alpha Pathway
|
|
Regulation of Lipid Metabolism by Peroxisome proliferator-activated receptor alpha (PPARalpha)
|
|
Transcriptional Regulation of White Adipocyte Differentiation
|
|
YAP1- and WWTR1 (TAZ)-stimulated gene expression
|
|
Activation of Gene Expression by SREBP (SREBF)
|
|
Adipogenesis
|
|
SREBF and miR33 in cholesterol and lipid homeostasis
|
|
Circadian Clock
|
|
Nuclear Receptors
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 2669). |
|---|
| REF 2 | PPAR alpha structure-function relationships derived from species-specific differences in responsiveness to hypolipidemic agents. Biol Chem. 1997 Jul;378(7):651-5. |
|---|
