| Drug General Information |
| Drug ID |
D07PYR
|
| Former ID |
DIB020776
|
| Drug Name |
pterostilbene
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
|
| Formula |
C16H16O3
|
| InChI |
InChI=1S/C16H16O3/c1-18-15-9-13(10-16(11-15)19-2)4-3-12-5-7-14(17)8-6-12/h3-11,17H,1-2H3/b4-3+
|
| InChIKey |
VLEUZFDZJKSGMX-ONEGZZNKSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
12473, 486766, 8616747, 12015690, 14798822, 24724573, 26657958, 26719768, 26759346, 39315341, 46386623, 47359680, 47509826, 50125420, 53757155, 53787588, 56312441, 56313494, 57358338, 57389464, 61013506, 74382048, 87225412, 88529866, 92308260, 92721406, 93375057, 103291397, 104022800, 104826074, 113855784, 118845193, 124659002, 124812965, 125307610, 126619185, 126660095, 126661713, 131317937, 134343766, 135114939, 135371714, 135610176, 135650865, 136376470, 137026810, 137169343, 142181328, 144089127, 162063211
|
| Target and Pathway |
| Target(s) |
Peroxisome proliferator activated receptor alpha |
Target Info |
Agonist |
[2]
|
|---|
|
KEGG Pathway
|
PPAR signaling pathway
|
|
cAMP signaling pathway
|
|
Adipocytokine signaling pathway
|
|
Glucagon signaling pathway
|
|
Non-alcoholic fatty liver disease (NAFLD)
|
|
Hepatitis C
|
|
Pathway Interaction Database
|
RXR and RAR heterodimerization with other nuclear receptor
|
|
Reactome
|
RORA activates gene expression
|
|
BMAL1:CLOCK,NPAS2 activates circadian gene expression
|
|
PPARA activates gene expression
|
|
YAP1- and WWTR1 (TAZ)-stimulated gene expression
|
|
Transcriptional activation of mitochondrial biogenesis
|
|
Activation of gene expression by SREBF (SREBP)
|
|
Transcriptional regulation of white adipocyte differentiation
|
|
Nuclear Receptor transcription pathway
|
|
Regulation of lipid metabolism by Peroxisome proliferator-activated receptor alpha (PPARalpha)
|
|
Circadian Clock
|
|
WikiPathways
|
Nuclear Receptors in Lipid Metabolism and Toxicity
|
|
Nuclear Receptors Meta-Pathway
|
|
Estrogen Receptor Pathway
|
|
PPAR Alpha Pathway
|
|
Regulation of Lipid Metabolism by Peroxisome proliferator-activated receptor alpha (PPARalpha)
|
|
Transcriptional Regulation of White Adipocyte Differentiation
|
|
YAP1- and WWTR1 (TAZ)-stimulated gene expression
|
|
Activation of Gene Expression by SREBP (SREBF)
|
|
Adipogenesis
|
|
SREBF and miR33 in cholesterol and lipid homeostasis
|
|
Circadian Clock
|
|
Nuclear Receptors
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 2681). |
|---|
| REF 2 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Target id: 593). |
|---|
