| Drug General Information |
| Drug ID |
D07OAT
|
| Former ID |
DNC001165
|
| Drug Name |
Purvalanol A
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C19H25ClN6O
|
| Canonical SMILES |
CC(C)C(CO)NC1=NC2=C(C(=N1)NC3=CC(=CC=C3)Cl)N=CN2C(C)C
|
| InChI |
1S/C19H25ClN6O/c1-11(2)15(9-27)23-19-24-17(22-14-7-5-6-13(20)8-14)16-18(25-19)26(10-21-16)12(3)4/h5-8,10-12,15,27H,9H2,1-4H3,(H2,22,23,24,25)/t15-/m0/s1
|
| InChIKey |
PMXCMJLOPOFPBT-HNNXBMFYSA-N
|
| CAS Number |
CAS 212844-53-6
|
| PubChem Compound ID |
|
| PubChem Substance ID |
7437576, 8153069, 10318964, 26759425, 29224060, 47810571, 50227717, 53800571, 99302804, 104013557, 104307953, 128939094, 134340168, 134340395, 137183851, 142430781, 163126032, 163687428, 175607504, 178102652, 179148896, 204361146, 208264792, 229338079
|
| Target and Pathway |
| Target(s) |
Cell division control protein 2 homolog |
Target Info |
Inhibitor |
[1]
|
|---|
|
KEGG Pathway
|
Cell cycle
|
|
Oocyte meiosis
|
|
p53 signaling pathway
|
|
Gap junction
|
|
Progesterone-mediated oocyte maturation
|
|
Herpes simplex infection
|
|
Epstein-Barr virus infection
|
|
Viral carcinogenesis
|
|
NetPath Pathway
|
RANKL Signaling Pathway
|
|
Pathway Interaction Database
|
p73 transcription factor network
|
|
E2F transcription factor network
|
|
PLK1 signaling events
|
|
AP-1 transcription factor network
|
|
FOXM1 transcription factor network
|
|
Retinoic acid receptors-mediated signaling
|
|
Reactome
|
MAPK3 (ERK1) activation
|
|
E2F mediated regulation of DNA replication
|
|
G0 and Early G1
|
|
Cyclin B2 mediated events
|
|
Golgi Cisternae Pericentriolar Stack Reorganization
|
|
Cdc20:Phospho-APC/C mediated degradation of Cyclin A
|
|
Regulation of APC/C activators between G1/S and early anaphase
|
|
Phosphorylation of the APC/C
|
|
Phosphorylation of Emi1
|
|
Condensation of Prophase Chromosomes
|
|
MASTL Facilitates Mitotic Progression
|
|
Resolution of Sister Chromatid Cohesion
|
|
Condensation of Prometaphase Chromosomes
|
|
Regulation of PLK1 Activity at G2/M Transition
|
|
Activation of NIMA Kinases NEK9, NEK6, NEK7
|
|
Loss of Nlp from mitotic centrosomes
|
|
Recruitment of mitotic centrosome proteins and complexes
|
|
Loss of proteins required for interphase microtubule organization?from the centrosome
|
|
Recruitment of NuMA to mitotic centrosomes
|
|
Depolymerisation of the Nuclear Lamina
|
|
Anchoring of the basal body to the plasma membrane
|
|
MAPK6/MAPK4 signaling
|
|
G1/S-Specific Transcription
|
|
Cyclin A/B1 associated events during G2/M transition
|
|
G2/M DNA replication checkpoint
|
|
Chk1/Chk2(Cds1) mediated inactivation of Cyclin B:Cdk1 complex
|
|
WikiPathways
|
DNA Damage Response
|
|
G1 to S cell cycle control
|
|
TGF beta Signaling Pathway
|
|
PPAR Alpha Pathway
|
|
MAP kinase activation in TLR cascade
|
|
RAF/MAP kinase cascade
|
|
Mitotic Prophase
|
|
Mitotic Prometaphase
|
|
BMI1
|
|
ATM Signaling Pathway
|
|
Retinoblastoma (RB) in Cancer
|
|
Spinal Cord Injury
|
|
Prostate Cancer
|
|
Regulation of Microtubule Cytoskeleton
|
|
Integrated Cancer pathway
|
|
Mitotic G2-G2/M phases
|
|
Mitotic G1-G1/S phases
|
|
Cell Cycle
|
|
APC/C-mediated degradation of cell cycle proteins
|
|
Cell Cycle Checkpoints
|
|
miRNA Regulation of DNA Damage Response
|
| References |
| REF 1 | Down-regulation of survivin in nitric oxide-induced cell growth inhibition and apoptosis of the human lung carcinoma cells. J Biol Chem. 2004 May 7;279(19):20267-76. Epub 2004 Feb 26. |
|---|
