| Drug General Information |
| Drug ID |
D08JML
|
| Former ID |
DNC000946
|
| Drug Name |
Microxine
|
| Drug Type |
Small molecular drug
|
| Indication |
Pain [ICD9: 338, 356.0, 356.8,780; ICD10:G64, G90.0, R52, G89]
|
Investigative |
[1]
|
|---|
| Therapeutic Class |
Analgesics
|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C8H11N5O4S
|
| Canonical SMILES |
CN1C2=C(NC1=O)N=CN=C2NCCS(=O)(=O)O
|
| InChI |
1S/C8H11N5O4S/c1-13-5-6(9-2-3-18(15,16)17)10-4-11-7(5)12-8(13)14/h4H,2-3H2,1H3,(H,15,16,17)(H2,9,10,11,12,14)
|
| InChIKey |
OTYWCUOKKIHICD-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
|
| Target and Pathway |
| Target(s) |
Cell division control protein 2 homolog |
Target Info |
Inhibitor |
[2]
|
|---|
| Prostaglandin G/H synthase 2 |
Target Info |
Inhibitor |
[1]
|
|
BioCyc Pathway
|
Aspirin-triggered lipoxin biosynthesis
|
|
Aspirin triggered resolvin D biosynthesis
|
|
C20 prostanoid biosynthesis
|
|
Aspirin triggered resolvin E biosynthesis
|
|
KEGG Pathway
|
Cell cycle
|
|
Oocyte meiosis
|
|
p53 signaling pathway
|
|
Gap junction
|
|
Progesterone-mediated oocyte maturation
|
|
Herpes simplex infection
|
|
Epstein-Barr virus infection
|
|
Viral carcinogenesishsa00590:Arachidonic acid metabolism
|
|
Metabolic pathways
|
|
NF-kappa B signaling pathway
|
|
VEGF signaling pathway
|
|
TNF signaling pathway
|
|
Retrograde endocannabinoid signaling
|
|
Serotonergic synapse
|
|
Ovarian steroidogenesis
|
|
Oxytocin signaling pathway
|
|
Regulation of lipolysis in adipocytes
|
|
Leishmaniasis
|
|
Pathways in cancer
|
|
Chemical carcinogenesis
|
|
MicroRNAs in cancer
|
|
Small cell lung cancer
|
|
NetPath Pathway
|
RANKL Signaling PathwayNetPath_13:IL1 Signaling Pathway
|
|
TSH Signaling Pathway
|
|
IL4 Signaling Pathway
|
|
TGF_beta_Receptor Signaling Pathway
|
|
IL5 Signaling Pathway
|
|
PANTHER Pathway
|
Endothelin signaling pathway
|
|
Inflammation mediated by chemokine and cytokine signaling pathway
|
|
Toll receptor signaling pathway
|
|
CCKR signaling map ST
|
|
Pathway Interaction Database
|
p73 transcription factor network
|
|
E2F transcription factor network
|
|
PLK1 signaling events
|
|
AP-1 transcription factor network
|
|
FOXM1 transcription factor network
|
|
Retinoic acid receptors-mediated signalingnfat_tfpathway:Calcineurin-regulated NFAT-dependent transcription in lymphocytes
|
|
S1P1 pathway
|
|
C-MYB transcription factor network
|
|
Signaling mediated by p38-alpha and p38-beta
|
|
Calcium signaling in the CD4+ TCR pathway
|
|
PathWhiz Pathway
|
Arachidonic Acid Metabolism
|
|
Reactome
|
MAPK3 (ERK1) activation
|
|
E2F mediated regulation of DNA replication
|
|
G0 and Early G1
|
|
Cyclin B2 mediated events
|
|
Golgi Cisternae Pericentriolar Stack Reorganization
|
|
Cdc20:Phospho-APC/C mediated degradation of Cyclin A
|
|
Regulation of APC/C activators between G1/S and early anaphase
|
|
Phosphorylation of the APC/C
|
|
Phosphorylation of Emi1
|
|
Condensation of Prophase Chromosomes
|
|
MASTL Facilitates Mitotic Progression
|
|
Resolution of Sister Chromatid Cohesion
|
|
Condensation of Prometaphase Chromosomes
|
|
Regulation of PLK1 Activity at G2/M Transition
|
|
Activation of NIMA Kinases NEK9, NEK6, NEK7
|
|
Loss of Nlp from mitotic centrosomes
|
|
Recruitment of mitotic centrosome proteins and complexes
|
|
Loss of proteins required for interphase microtubule organization?from the centrosome
|
|
Recruitment of NuMA to mitotic centrosomes
|
|
Depolymerisation of the Nuclear Lamina
|
|
Anchoring of the basal body to the plasma membrane
|
|
MAPK6/MAPK4 signaling
|
|
G1/S-Specific Transcription
|
|
Cyclin A/B1 associated events during G2/M transition
|
|
G2/M DNA replication checkpoint
|
|
Chk1/Chk2(Cds1) mediated inactivation of Cyclin B:Cdk1 complex
|
|
WikiPathways
|
DNA Damage Response
|
|
G1 to S cell cycle control
|
|
TGF beta Signaling Pathway
|
|
PPAR Alpha Pathway
|
|
MAP kinase activation in TLR cascade
|
|
RAF/MAP kinase cascade
|
|
Mitotic Prophase
|
|
Mitotic Prometaphase
|
|
BMI1
|
|
ATM Signaling Pathway
|
|
Retinoblastoma (RB) in Cancer
|
|
Spinal Cord Injury
|
|
Prostate Cancer
|
|
Regulation of Microtubule Cytoskeleton
|
|
Integrated Cancer pathway
|
|
Mitotic G2-G2/M phases
|
|
Mitotic G1-G1/S phases
|
|
Cell Cycle
|
|
APC/C-mediated degradation of cell cycle proteins
|
|
Cell Cycle Checkpoints
|
|
miRNA Regulation of DNA Damage ResponseWP98:Prostaglandin Synthesis and Regulation
|
|
Arachidonic acid metabolism
|
|
Aryl Hydrocarbon Receptor
|
|
Quercetin and Nf-kB/ AP-1 Induced Cell Apoptosis
|
|
Integrated Pancreatic Cancer Pathway
|
|
Eicosanoid Synthesis
|
|
Selenium Micronutrient Network
|
| References |
| REF 1 | Inhibition of cell cycle oscillation of DNA replication by a selective inhibitor of the cdc2 kinase family, butyrolactone I, in Xenopus egg extracts. Biochem Biophys Res Commun. 1994 Jan 28;198(2):536-45. |
|---|
| REF 2 | Microxine, a new cdc2 kinase inhibitor from the Australian marine sponge Microxina species. J Nat Prod. 2001 Apr;64(4):525-6. |
|---|
