| Drug General Information |
| Drug ID |
D03SZR
|
| Former ID |
DPR000147
|
| Drug Name |
M-carboxycinnamic acid bishydroxamide
|
| Synonyms |
Cbha; Histone Deacetylase Inhibitor II; HDInhib_000062; M-Carboxycinnamic Acid bis-Hydroxamide; N-hydroxy-3-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide
|
| Drug Type |
Small molecular drug
|
| Indication |
Cancer [ICD9: 140-229; ICD10:C00-C96]
|
Preclinical |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C10H10N2O4
|
| Canonical SMILES |
C1=CC(=CC(=C1)C(=O)NO)C=CC(=O)NO
|
| InChI |
1S/C10H10N2O4/c13-9(11-15)5-4-7-2-1-3-8(6-7)10(14)12-16/h1-6,15-16H,(H,11,13)(H,12,14)/b5-4+
|
| InChIKey |
OYKBQNOPCSXWBL-SNAWJCMRSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
11651310, 12015515, 15195991, 26758880, 39379641, 47885214, 52557503, 53787944, 57361550, 99375466, 113909289, 121379811, 134964539, 152039135, 162257830, 163687964, 164837755, 175608094, 204377914, 226971267, 252457244, 252467053
|
| Target and Pathway |
| Target(s) |
Histone deacetylase 1 |
Target Info |
Inhibitor |
[2],
[3]
|
|---|
|
KEGG Pathway
|
Cell cycle
|
|
Notch signaling pathway
|
|
Thyroid hormone signaling pathway
|
|
Huntington's disease
|
|
Amphetamine addiction
|
|
Alcoholism
|
|
Epstein-Barr virus infection
|
|
Pathways in cancer
|
|
Transcriptional misregulation in cancer
|
|
Viral carcinogenesis
|
|
MicroRNAs in cancer
|
|
Chronic myeloid leukemia
|
|
NetPath Pathway
|
TCR Signaling Pathway
|
|
PANTHER Pathway
|
Wnt signaling pathway
|
|
p53 pathway
|
|
Pathway Interaction Database
|
Regulation of nuclear SMAD2/3 signaling
|
|
Notch signaling pathway
|
|
E2F transcription factor network
|
|
Presenilin action in Notch and Wnt signaling
|
|
Signaling events mediated by HDAC Class I
|
|
Regulation of Telomerase
|
|
Glucocorticoid receptor regulatory network
|
|
Sumoylation by RanBP2 regulates transcriptional repression
|
|
Regulation of Androgen receptor activity
|
|
IL3-mediated signaling events
|
|
Validated nuclear estrogen receptor alpha network
|
|
Retinoic acid receptors-mediated signaling
|
|
Hedgehog signaling events mediated by Gli proteins
|
|
Regulation of nuclear beta catenin signaling and target gene transcription
|
|
Validated targets of C-MYC transcriptional repression
|
|
Regulation of retinoblastoma protein
|
|
Notch-mediated HES/HEY network
|
|
Reactome
|
G0 and Early G1
|
|
p75NTR negatively regulates cell cycle via SC1
|
|
Formation of the beta-catenin:TCF transactivating complex
|
|
NOTCH1 Intracellular Domain Regulates Transcription
|
|
SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription
|
|
Constitutive Signaling by NOTCH1 PEST Domain Mutants
|
|
Constitutive Signaling by NOTCH1 HD+PEST Domain Mutants
|
|
HDACs deacetylate histones
|
|
Deactivation of the beta-catenin transactivating complex
|
|
NoRC negatively regulates rRNA expression
|
|
RNA Polymerase I Transcription Initiation
|
|
Factors involved in megakaryocyte development and platelet production
|
|
WikiPathways
|
SIDS Susceptibility Pathways
|
|
Notch Signaling Pathway
|
|
TGF beta Signaling Pathway
|
|
IL-6 signaling pathway
|
|
Apoptosis-related network due to altered Notch3 in ovarian cancer
|
|
Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer
|
|
Notch Signaling Pathway
|
|
Retinoblastoma (RB) in Cancer
|
|
Neural Crest Differentiation
|
|
TWEAK Signaling Pathway
|
|
Integrated Breast Cancer Pathway
|
|
Signalling by NGF
|
|
RNA Polymerase I, RNA Polymerase III, and Mitochondrial Transcription
|
|
Mitotic G1-G1/S phases
|
|
Factors involved in megakaryocyte development and platelet production
|
|
Cell Cycle
|
|
Androgen receptor signaling pathway
|
| References |
| REF 1 | Selective extraction of an intrinsic fat-cell plasma-membrane glycoprotein by Triton X-100. Correlation with [3H]cytochalasin B binding activity. FEBS Lett. 1977 Nov 1;83(1):71-5. |
|---|
| REF 2 | Anticancer activities of histone deacetylase inhibitors. Nat Rev Drug Discov. 2006 Sep;5(9):769-84. |
|---|
| REF 3 | Histone deacetylase inhibitors in cancer therapy: latest developments, trends and medicinal chemistry perspective. Anticancer Agents Med Chem. 2007 Sep;7(5):576-92. |
|---|
