| Drug General Information |
| Drug ID |
D04YOT
|
| Former ID |
DNC003579
|
| Drug Name |
1-Naphthalen-1-yl-piperazine
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
|
| Formula |
C14H16N2
|
| Canonical SMILES |
C1CN(CCN1)C2=CC=CC3=CC=CC=C32
|
| InChI |
1S/C14H16N2/c1-2-6-13-12(4-1)5-3-7-14(13)16-10-8-15-9-11-16/h1-7,15H,8-11H2
|
| InChIKey |
VNICFCQJUVFULD-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
5-hydroxytryptamine 1D receptor |
Target Info |
Inhibitor |
[2]
|
|---|
| 5-hydroxytryptamine 7 receptor |
Target Info |
Inhibitor |
[1]
|
| 5-hydroxytryptamine 1A receptor |
Target Info |
Inhibitor |
[2]
|
| 5-hydroxytryptamine 2A receptor |
Target Info |
Inhibitor |
[2]
|
| 5-hydroxytryptamine 6 receptor |
Target Info |
Inhibitor |
[3]
|
|
KEGG Pathway
|
cAMP signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
Serotonergic synapsehsa04014:Ras signaling pathway
|
|
Calcium signaling pathway
|
|
Serotonergic synapsehsa04024:cAMP signaling pathway
|
|
Serotonergic synapsehsa04020:Calcium signaling pathway
|
|
Gap junction
|
|
Serotonergic synapse
|
|
Inflammatory mediator regulation of TRP channelshsa04020:Calcium signaling pathway
|
|
PANTHER Pathway
|
Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
5HT1 type receptor mediated signaling pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
5HT1 type receptor mediated signaling pathwayP04374:5HT2 type receptor mediated signaling pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
PathWhiz Pathway
|
Excitatory Neural Signalling Through 5-HTR 7 and SerotoninPW000444:Excitatory Neural Signalling Through 5-HTR 6 and Serotonin
|
|
Reactome
|
Serotonin receptors
|
|
G alpha (i) signalling eventsR-HSA-390666:Serotonin receptors
|
|
G alpha (s) signalling eventsR-HSA-390666:Serotonin receptors
|
|
G alpha (q) signalling eventsR-HSA-390666:Serotonin receptors
|
|
G alpha (s) signalling events
|
|
WikiPathways
|
Serotonin HTR1 Group and FOS Pathway
|
|
Monoamine GPCRs
|
|
GPCRs, Class A Rhodopsin-like
|
|
GPCR ligand binding
|
|
GPCR downstream signalingWP734:Serotonin Receptor 4/6/7 and NR3C Signaling
|
|
GPCR downstream signaling
|
|
GPCRs, OtherWP722:Serotonin HTR1 Group and FOS Pathway
|
|
SIDS Susceptibility Pathways
|
|
GPCR downstream signalingWP733:Serotonin Receptor 2 and STAT3 Signaling
|
|
Serotonin Receptor 2 and ELK-SRF/GATA4 signaling
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
GPCRs, OtherWP734:Serotonin Receptor 4/6/7 and NR3C Signaling
|
| References |
| REF 1 | J Med Chem. 2003 Jul 3;46(14):2795-812.Higher-end serotonin receptors: 5-HT(5), 5-HT(6), and 5-HT(7). |
|---|
| REF 2 | J Med Chem. 1986 Nov;29(11):2375-80.5-HT1 and 5-HT2 binding characteristics of some quipazine analogues. |
|---|
| REF 3 | Bioorg Med Chem Lett. 2005 Mar 15;15(6):1707-11.1-(1-Naphthyl)piperazine as a novel template for 5-HT6 serotonin receptor ligands. |
|---|
