| Drug General Information |
| Drug ID |
D0E7PQ
|
| Former ID |
DAP001082
|
| Drug Name |
Vorinostat
|
| Synonyms |
NHNPODA; SAHA; SHH; Zolinza; Merck brand of Vorinostat; OCTANEDIOIC ACID HYDROXYAMIDE PHENYLAMIDE; SAHA cpd; Suberanilohydroxamic acid; Suberoylanilide hydroxamic acid; Vorinostat MSD; Vorinostat [USAN]; M344; MK0683; SKI390; WIN64652; MK-0683; SAHA, Suberoylanilide hydroxamic acid; SW-064652; Zolinza (TN); Vorinostat (JAN/USAN); N1-hydroxy-N8-phenyloctanediamide; Zolinza, MK-0683, SAHA; N'-hydroxy-N-phenyloctanediamide; N-Hydroxy-N'-phenyl octanediamide; N-Hyrdroxy-N'-phenyloctanediamide; N-hydroxy-N'-phenyloctanediamide; N-hydroxy-N'-phenyl-octane-1,8-diotic acid diamide; Vorinostat (HDAC inhibitor)
|
| Drug Type |
Small molecular drug
|
| Indication |
Cutaneous T-cell lymphoma [ICD9: 202.1, 202.2; ICD10:C84.0, C84.1]
|
Approved |
[1],
[2]
|
|---|
| Therapeutic Class |
Anticancer Agents
|
| Company |
Merck
|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C14H20N2O3
|
| InChI |
InChI=1S/C14H20N2O3/c17-13(15-12-8-4-3-5-9-12)10-6-1-2-7-11-14(18)16-19/h3-5,8-9,19H,1-2,6-7,10-11H2,(H,15,17)(H,16,18)
|
| InChIKey |
WAEXFXRVDQXREF-UHFFFAOYSA-N
|
| CAS Number |
CAS 149647-78-9
|
| PubChem Compound ID |
|
| PubChem Substance ID |
830547, 832844, 5620782, 7890463, 8153256, 12015019, 14710657, 14823867, 26684150, 29224365, 46393757, 46508989, 46519184, 47207977, 48426290, 49645508, 50070170, 50070537, 50071316, 50113029, 53788318, 56311712, 56312417, 56312644, 56314569, 57322702, 68530763, 75748492, 85736432, 87226482, 92708291, 92719823, 99350949, 99436957, 103174146, 104170365, 104171411, 104308873, 118048589, 121362164, 124756962, 124766849, 124795966, 124893441, 124893442, 125163768, 125335517, 126591282, 126628079, 126649066
|
| SuperDrug ATC ID |
L01XX38
|
| Target and Pathway |
| Target(s) |
Histone deacetylase 1 |
Target Info |
Inhibitor |
[3],
[4],
[5]
|
|---|
|
KEGG Pathway
|
Cell cycle
|
|
Notch signaling pathway
|
|
Thyroid hormone signaling pathway
|
|
Huntington's disease
|
|
Amphetamine addiction
|
|
Alcoholism
|
|
Epstein-Barr virus infection
|
|
Pathways in cancer
|
|
Transcriptional misregulation in cancer
|
|
Viral carcinogenesis
|
|
MicroRNAs in cancer
|
|
Chronic myeloid leukemia
|
|
NetPath Pathway
|
TCR Signaling Pathway
|
|
PANTHER Pathway
|
Wnt signaling pathway
|
|
p53 pathway
|
|
Pathway Interaction Database
|
Regulation of nuclear SMAD2/3 signaling
|
|
Notch signaling pathway
|
|
E2F transcription factor network
|
|
Presenilin action in Notch and Wnt signaling
|
|
Signaling events mediated by HDAC Class I
|
|
Regulation of Telomerase
|
|
Glucocorticoid receptor regulatory network
|
|
Sumoylation by RanBP2 regulates transcriptional repression
|
|
Regulation of Androgen receptor activity
|
|
IL3-mediated signaling events
|
|
Validated nuclear estrogen receptor alpha network
|
|
Retinoic acid receptors-mediated signaling
|
|
Hedgehog signaling events mediated by Gli proteins
|
|
Regulation of nuclear beta catenin signaling and target gene transcription
|
|
Validated targets of C-MYC transcriptional repression
|
|
Regulation of retinoblastoma protein
|
|
Notch-mediated HES/HEY network
|
|
Reactome
|
G0 and Early G1
|
|
p75NTR negatively regulates cell cycle via SC1
|
|
Formation of the beta-catenin:TCF transactivating complex
|
|
NOTCH1 Intracellular Domain Regulates Transcription
|
|
SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription
|
|
Constitutive Signaling by NOTCH1 PEST Domain Mutants
|
|
Constitutive Signaling by NOTCH1 HD+PEST Domain Mutants
|
|
HDACs deacetylate histones
|
|
Deactivation of the beta-catenin transactivating complex
|
|
NoRC negatively regulates rRNA expression
|
|
RNA Polymerase I Transcription Initiation
|
|
Factors involved in megakaryocyte development and platelet production
|
|
WikiPathways
|
SIDS Susceptibility Pathways
|
|
Notch Signaling Pathway
|
|
TGF beta Signaling Pathway
|
|
IL-6 signaling pathway
|
|
Apoptosis-related network due to altered Notch3 in ovarian cancer
|
|
Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer
|
|
Notch Signaling Pathway
|
|
Retinoblastoma (RB) in Cancer
|
|
Neural Crest Differentiation
|
|
TWEAK Signaling Pathway
|
|
Integrated Breast Cancer Pathway
|
|
Signalling by NGF
|
|
RNA Polymerase I, RNA Polymerase III, and Mitochondrial Transcription
|
|
Mitotic G1-G1/S phases
|
|
Factors involved in megakaryocyte development and platelet production
|
|
Cell Cycle
|
|
Androgen receptor signaling pathway
|
| References |
| REF 1 | Emerging therapies for multiple myeloma. Expert Opin Emerg Drugs. 2009 Mar;14(1):99-127. |
|---|
| REF 2 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 6852). |
|---|
| REF 3 | Anticancer activities of histone deacetylase inhibitors. Nat Rev Drug Discov. 2006 Sep;5(9):769-84. |
|---|
| REF 4 | Discovery of a potent class I selective ketone histone deacetylase inhibitor with antitumor activity in vivo and optimized pharmacokinetic properties. J Med Chem. 2009 Jun 11;52(11):3453-6. |
|---|
| REF 5 | Protein methyltransferases as a target class for drug discovery. Nat Rev Drug Discov. 2009 Sep;8(9):724-32. |
|---|
