| Drug General Information |
| Drug ID |
D02YAQ
|
| Former ID |
DIB011889
|
| Drug Name |
GW-974
|
| Synonyms |
GW-282974; GW-2974; GW-449; GW-734; GW-9263; Erb B-2 inhibitor, Glaxo Wellcome
|
| Indication |
Breast cancer [ICD9: 174, 175; ICD10:C50]
|
Terminated |
[1]
|
|---|
| Company |
Glaxo Wellcome plc
|
| Structure |
|
Download
2D MOL
3D MOL
|
| Canonical SMILES |
n1(ncc2c1ccc(Nc1c3cc(ncc3ncn1)N(C)C)c2)Cc1ccccc1
|
| Target and Pathway |
| Target(s) |
Receptor protein-tyrosine kinase erbB-2 |
Target Info |
Inhibitor |
[2]
|
|---|
|
KEGG Pathway
|
ErbB signaling pathway
|
|
Calcium signaling pathway
|
|
HIF-1 signaling pathway
|
|
Focal adhesion
|
|
Adherens junction
|
|
Pathways in cancer
|
|
Proteoglycans in cancer
|
|
MicroRNAs in cancer
|
|
Pancreatic cancer
|
|
Endometrial cancer
|
|
Prostate cancer
|
|
Bladder cancer
|
|
Non-small cell lung cancer
|
|
Central carbon metabolism in cancer
|
|
NetPath Pathway
|
TCR Signaling Pathway
|
|
PANTHER Pathway
|
Cadherin signaling pathway
|
|
EGF receptor signaling pathway
|
|
Pathway Interaction Database
|
ErbB4 signaling events
|
|
ErbB2/ErbB3 signaling events
|
|
ErbB receptor signaling network
|
|
a6b1 and a6b4 Integrin signaling
|
|
Validated targets of C-MYC transcriptional repression
|
|
PathWhiz Pathway
|
Phosphatidylinositol Phosphate Metabolism
|
|
Reactome
|
SHC1 events in ERBB2 signaling
|
|
PLCG1 events in ERBB2 signaling
|
|
PIP3 activates AKT signaling
|
|
GRB2 events in ERBB2 signaling
|
|
PI3K events in ERBB2 signaling
|
|
Constitutive Signaling by Aberrant PI3K in Cancer
|
|
Sema4D induced cell migration and growth-cone collapse
|
|
RAF/MAP kinase cascade
|
|
WikiPathways
|
DNA Damage Response (only ATM dependent)
|
|
ErbB Signaling Pathway
|
|
EGF/EGFR Signaling Pathway
|
|
Focal Adhesion
|
|
Extracellular vesicle-mediated signaling in recipient cells
|
|
Bladder Cancer
|
|
Signaling by ERBB2
|
|
Integrated Pancreatic Cancer Pathway
|
|
Signaling Pathways in Glioblastoma
|
|
Leptin signaling pathway
|
|
miR-targeted genes in muscle cell - TarBase
|
|
Semaphorin interactions
|
| References |
| REF 1 | Trusted, scientifically sound profiles of drug programs, clinical trials, safety reports, and company deals, written by scientists. Springer. 2015. Adis Insight (drug id 800010108) |
|---|
| REF 2 | WO patent application no. 2005,0443,02, Selective erbb2 inhibitor/anti-erbb antibody combinations in the treatment of cancer. |
|---|
