| Drug General Information |
| Drug ID |
D0W9NH
|
| Former ID |
DCL001122
|
| Drug Name |
Tacedinaline
|
| Synonyms |
Acetyldinaline; Tacedinalina; Goe 5549; PD 123654; Ci-994; Goe-5549; PD-123654; Tacedinalina [INN-Spanish]; Tacedinaline [USAN:INN]; C.I. 994; Tacedinaline (USAN/INN); 4-(Acetylamino)-N-(2-aminophenyl)benzamide; 4-acetamido-N-(2-aminophenyl)benzamide; 4-acetamido-n-(2-aminophenyl)benzamid; 4-acetylamino-N-(2'-aminophenyl)benzamide
|
| Drug Type |
Small molecular drug
|
| Indication |
Cancer [ICD9: 140-229; ICD10:C00-C96]
|
Discontinued in Phase 2 |
[1],
[2]
|
|---|
| Company |
National Cancer Institute (NCI)
|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C15H15N3O2
|
| InChI |
InChI=1S/C15H15N3O2/c1-10(19)17-12-8-6-11(7-9-12)15(20)18-14-5-3-2-4-13(14)16/h2-9H,16H2,1H3,(H,17,19)(H,18,20)
|
| InChIKey |
VAZAPHZUAVEOMC-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
6897908, 8151773, 12014151, 14848338, 29221901, 46519444, 47207646, 49875144, 57321429, 76461531, 87226490, 93619303, 103137194, 103537395, 104301487, 117537664, 118843066, 121363787, 123391000, 124360040, 125338021, 126671706, 129449051, 134345068, 134964212, 135074618, 135698188, 136367989, 137022499, 137237670, 141654160, 144115829, 152029810, 152159635, 152186807, 160871335, 162012039, 162205195, 162248589, 163121968, 163621122, 163686462, 164193980, 164224003, 164824268, 172095414, 172911911, 175608160, 179148456, 184538256
|
| Target and Pathway |
| Target(s) |
Histone deacetylase 1 |
Target Info |
Inhibitor |
[3],
[4]
|
|---|
|
KEGG Pathway
|
Cell cycle
|
|
Notch signaling pathway
|
|
Thyroid hormone signaling pathway
|
|
Huntington's disease
|
|
Amphetamine addiction
|
|
Alcoholism
|
|
Epstein-Barr virus infection
|
|
Pathways in cancer
|
|
Transcriptional misregulation in cancer
|
|
Viral carcinogenesis
|
|
MicroRNAs in cancer
|
|
Chronic myeloid leukemia
|
|
NetPath Pathway
|
TCR Signaling Pathway
|
|
PANTHER Pathway
|
Wnt signaling pathway
|
|
p53 pathway
|
|
Pathway Interaction Database
|
Regulation of nuclear SMAD2/3 signaling
|
|
Notch signaling pathway
|
|
E2F transcription factor network
|
|
Presenilin action in Notch and Wnt signaling
|
|
Signaling events mediated by HDAC Class I
|
|
Regulation of Telomerase
|
|
Glucocorticoid receptor regulatory network
|
|
Sumoylation by RanBP2 regulates transcriptional repression
|
|
Regulation of Androgen receptor activity
|
|
IL3-mediated signaling events
|
|
Validated nuclear estrogen receptor alpha network
|
|
Retinoic acid receptors-mediated signaling
|
|
Hedgehog signaling events mediated by Gli proteins
|
|
Regulation of nuclear beta catenin signaling and target gene transcription
|
|
Validated targets of C-MYC transcriptional repression
|
|
Regulation of retinoblastoma protein
|
|
Notch-mediated HES/HEY network
|
|
Reactome
|
G0 and Early G1
|
|
p75NTR negatively regulates cell cycle via SC1
|
|
Formation of the beta-catenin:TCF transactivating complex
|
|
NOTCH1 Intracellular Domain Regulates Transcription
|
|
SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription
|
|
Constitutive Signaling by NOTCH1 PEST Domain Mutants
|
|
Constitutive Signaling by NOTCH1 HD+PEST Domain Mutants
|
|
HDACs deacetylate histones
|
|
Deactivation of the beta-catenin transactivating complex
|
|
NoRC negatively regulates rRNA expression
|
|
RNA Polymerase I Transcription Initiation
|
|
Factors involved in megakaryocyte development and platelet production
|
|
WikiPathways
|
SIDS Susceptibility Pathways
|
|
Notch Signaling Pathway
|
|
TGF beta Signaling Pathway
|
|
IL-6 signaling pathway
|
|
Apoptosis-related network due to altered Notch3 in ovarian cancer
|
|
Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer
|
|
Notch Signaling Pathway
|
|
Retinoblastoma (RB) in Cancer
|
|
Neural Crest Differentiation
|
|
TWEAK Signaling Pathway
|
|
Integrated Breast Cancer Pathway
|
|
Signalling by NGF
|
|
RNA Polymerase I, RNA Polymerase III, and Mitochondrial Transcription
|
|
Mitotic G1-G1/S phases
|
|
Factors involved in megakaryocyte development and platelet production
|
|
Cell Cycle
|
|
Androgen receptor signaling pathway
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 8367). |
|---|
| REF 2 | Trusted, scientifically sound profiles of drug programs, clinical trials, safety reports, and company deals, written by scientists. Springer. 2015. Adis Insight (drug id 800002525) |
|---|
| REF 3 | Anticancer activities of histone deacetylase inhibitors. Nat Rev Drug Discov. 2006 Sep;5(9):769-84. |
|---|
| REF 4 | Histone deacetylase inhibitors in cancer therapy: latest developments, trends and medicinal chemistry perspective. Anticancer Agents Med Chem. 2007 Sep;7(5):576-92. |
|---|
