| Drug General Information |
| Drug ID |
D02FPF
|
| Former ID |
DNC008339
|
| Drug Name |
JUGLONE
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C10H6O3
|
| Canonical SMILES |
C1=CC2=C(C(=O)C=CC2=O)C(=C1)O
|
| InChI |
1S/C10H6O3/c11-7-4-5-9(13)10-6(7)2-1-3-8(10)12/h1-5,12H
|
| InChIKey |
KQPYUDDGWXQXHS-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Dual specificity protein phosphatase 1 |
Target Info |
Inhibitor |
[2]
|
|---|
| Arachidonate 5-lipoxygenase |
Target Info |
Inhibitor |
[3]
|
| M-phase inducer phosphatase 2 |
Target Info |
Inhibitor |
[2]
|
| Indoleamine 2,3-dioxygenase |
Target Info |
Inhibitor |
[1]
|
|
BioCyc Pathway
|
Aspirin-triggered lipoxin biosynthesis
|
|
Resolvin D biosynthesis
|
|
Leukotriene biosynthesis
|
|
Lipoxin biosynthesis
|
|
Aspirin triggered resolvin D biosynthesis
|
|
Aspirin triggered resolvin E biosynthesisPWY66-401:Superpathway of tryptophan utilization
|
|
Tryptophan degradation
|
|
L-kynurenine degradation
|
|
Tryptophan degradation to 2-amino-3-carboxymuconate semialdehyde
|
|
NAD de novo biosynthesis
|
|
KEGG Pathway
|
MAPK signaling pathway
|
|
Serotonergic synapsehsa00590:Arachidonic acid metabolism
|
|
Metabolic pathways
|
|
Serotonergic synapse
|
|
Ovarian steroidogenesis
|
|
Toxoplasmosishsa04010:MAPK signaling pathway
|
|
Cell cycle
|
|
Progesterone-mediated oocyte maturation
|
|
MicroRNAs in cancerhsa00380:Tryptophan metabolism
|
|
African trypanosomiasis
|
|
NetPath Pathway
|
FSH Signaling Pathway
|
|
IL2 Signaling Pathway
|
|
EGFR1 Signaling Pathway
|
|
Wnt Signaling Pathway
|
|
TCR Signaling PathwayNetPath_16:IL4 Signaling PathwayNetPath_14:IL2 Signaling Pathway
|
|
TGF_beta_Receptor Signaling Pathway
|
|
Wnt Signaling PathwayNetPath_24:TSLP Signaling Pathway
|
|
IL5 Signaling Pathway
|
|
Pathway Interaction Database
|
Fc-epsilon receptor I signaling in mast cells
|
|
Regulation of p38-alpha and p38-beta
|
|
Direct p53 effectors
|
|
ErbB1 downstream signaling
|
|
ATF-2 transcription factor network
|
|
AP-1 transcription factor networkplk1_pathway:PLK1 signaling events
|
|
FOXM1 transcription factor network
|
|
p38 signaling mediated by MAPKAP kinases
|
|
Aurora A signaling
|
|
PathWhiz Pathway
|
Arachidonic Acid MetabolismPW000163:Tryptophan Metabolism
|
|
Reactome
|
RAF-independent MAPK1/3 activation
|
|
Negative regulation of MAPK pathwayR-HSA-157881:Cyclin B2 mediated events
|
|
Cyclin A/B1 associated events during G2/M transition
|
|
Cyclin A:Cdk2-associated events at S phase entryR-HSA-71240:Tryptophan catabolism
|
|
WikiPathways
|
MAPK Signaling PathwayWP2877:Vitamin D Receptor Pathway
|
|
Arachidonic acid metabolism
|
|
Eicosanoid Synthesis
|
|
Selenium Micronutrient NetworkWP615:Senescence and Autophagy in Cancer
|
|
MAPK Signaling Pathway
|
|
Retinoblastoma (RB) in Cancer
|
|
Prostate Cancer
|
|
Integrated Breast Cancer Pathway
|
|
Integrated Cancer pathway
|
|
Mitotic G2-G2/M phases
|
|
Cell CycleWP465:Tryptophan metabolism
|
|
Metabolism of amino acids and derivatives
|
| References |
| REF 1 | J Med Chem. 2008 Mar 27;51(6):1706-18. Epub 2008 Mar 5.Indoleamine 2,3-dioxygenase is the anticancer target for a novel series of potent naphthoquinone-based inhibitors. |
|---|
| REF 2 | Bioorg Med Chem. 2009 Mar 15;17(6):2276-81. Epub 2008 Nov 8.Bioactivities of simplified adociaquinone B and naphthoquinone derivatives against Cdc25B, MKP-1, and MKP-3 phosphatases. |
|---|
| REF 3 | J Med Chem. 1997 Nov 7;40(23):3773-80.Simple analogues of anthralin: unusual specificity of structure and antiproliferative activity. |
|---|
