| Drug General Information |
| Drug ID |
D07MBC
|
| Former ID |
DIB020558
|
| Drug Name |
N-oleoylethanolamide
|
| Synonyms |
N-oleoylethanolamine; oleylethanolamide; NOE; OEA
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C20H39NO2
|
| InChI |
InChI=1S/C20H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)21-18-19-22/h9-10,22H,2-8,11-19H2,1H3,(H,21,23)/b10-9-
|
| InChIKey |
BOWVQLFMWHZBEF-KTKRTIGZSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
7850594, 11039003, 11111564, 11114103, 14801663, 17405500, 24278603, 26752201, 26752202, 26759287, 39316864, 47662426, 48185106, 49681175, 49998734, 50104865, 50104866, 53778048, 56365486, 56365865, 56463012, 57358922, 76839960, 81054509, 85231163, 90341098, 91721840, 92304360, 103178679, 112379007, 113860131, 118843673, 121361710, 121404012, 123050584, 124750115, 124800447, 124880955, 124880956, 124880957, 124880958, 126524346, 131294564, 134343544, 135025785, 135651533, 135653823, 135707348, 136894919, 137027986
|
| Target and Pathway |
| Target(s) |
Peroxisome proliferator activated receptor alpha |
Target Info |
Agonist |
[2]
|
|---|
| G-protein coupled receptor 55 |
Target Info |
Agonist |
[3]
|
| Glucose-dependent insulinotropic receptor |
Target Info |
Agonist |
[4]
|
|
KEGG Pathway
|
PPAR signaling pathway
|
|
cAMP signaling pathway
|
|
Adipocytokine signaling pathway
|
|
Glucagon signaling pathway
|
|
Non-alcoholic fatty liver disease (NAFLD)
|
|
Hepatitis Chsa04024:cAMP signaling pathway
|
|
Insulin secretion
|
|
Pathway Interaction Database
|
RXR and RAR heterodimerization with other nuclear receptor
|
|
Reactome
|
RORA activates gene expression
|
|
BMAL1:CLOCK,NPAS2 activates circadian gene expression
|
|
PPARA activates gene expression
|
|
YAP1- and WWTR1 (TAZ)-stimulated gene expression
|
|
Transcriptional activation of mitochondrial biogenesis
|
|
Activation of gene expression by SREBF (SREBP)
|
|
Transcriptional regulation of white adipocyte differentiation
|
|
Nuclear Receptor transcription pathway
|
|
Regulation of lipid metabolism by Peroxisome proliferator-activated receptor alpha (PPARalpha)
|
|
Circadian ClockR-HSA-373076:Class A/1 (Rhodopsin-like receptors)
|
|
G alpha (i) signalling events
|
|
WikiPathways
|
Nuclear Receptors in Lipid Metabolism and Toxicity
|
|
Nuclear Receptors Meta-Pathway
|
|
Estrogen Receptor Pathway
|
|
PPAR Alpha Pathway
|
|
Regulation of Lipid Metabolism by Peroxisome proliferator-activated receptor alpha (PPARalpha)
|
|
Transcriptional Regulation of White Adipocyte Differentiation
|
|
YAP1- and WWTR1 (TAZ)-stimulated gene expression
|
|
Activation of Gene Expression by SREBP (SREBF)
|
|
Adipogenesis
|
|
SREBF and miR33 in cholesterol and lipid homeostasis
|
|
Circadian Clock
|
|
Nuclear ReceptorsWP1825:GPCR ligand binding
|
|
GPCR downstream signaling
|
|
GPCRs, OtherWP2728:Incretin Synthesis, Secretion, and Inactivation
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 2661). |
|---|
| REF 2 | Oleoylethanolamide, an endogenous PPAR-alpha agonist, lowers body weight and hyperlipidemia in obese rats. Neuropharmacology. 2005 Jun;48(8):1147-53. Epub 2005 Apr 21. |
|---|
| REF 3 | The orphan receptor GPR55 is a novel cannabinoid receptor. Br J Pharmacol. 2007 Dec;152(7):1092-101. Epub 2007 Sep 17. |
|---|
| REF 4 | Screening beta-arrestin recruitment for the identification of natural ligands for orphan G-protein-coupled receptors. J Biomol Screen. 2013 Jun;18(5):599-609. |
|---|
