| Drug General Information |
| Drug ID |
D08RJC
|
| Former ID |
DNC004169
|
| Drug Name |
PD-32577
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C29H42N2O2
|
| Canonical SMILES |
CC(C)(C1=CC(=C(C=C1)O)CN2CCCCCC2)C3=CC(=C(C=C3)O)CN4CCC<br />CCC4
|
| InChI |
1S/C29H42N2O2/c1-29(2,25-11-13-27(32)23(19-25)21-30-15-7-3-4-8-16-30)26-12-14-28(33)24(20-26)22-31-17-9-5-6-10-18-31/h11-14,19-20,32-33H,3-10,15-18,21-22H2,1-2H3
|
| InChIKey |
GHZGEEOGCPBASL-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Voltage-dependent N-type calcium channel |
Target Info |
Inhibitor |
[1]
|
|---|
| Voltage-dependent L-type calcium channel subunit alpha-1C |
Target Info |
Inhibitor |
[1]
|
| Potassium voltage-gated channel subfamily KQT member 3 |
Target Info |
Inhibitor |
[1]
|
| Potassium voltage-gated channel subfamily KQT member 2 |
Target Info |
Inhibitor |
[1]
|
| PN3 Na+ channel |
Target Info |
Inhibitor |
[1]
|
| Voltage-dependent L-type calcium channel alpha-1D subunit |
Target Info |
Inhibitor |
[1]
|
| Voltage-gated sodium channel subunit alpha Nav1.9 |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
MAPK signaling pathway
|
|
Calcium signaling pathway
|
|
Synaptic vesicle cycle
|
|
Retrograde endocannabinoid signaling
|
|
Cholinergic synapse
|
|
Serotonergic synapse
|
|
GABAergic synapse
|
|
Dopaminergic synapse
|
|
Taste transduction
|
|
Type II diabetes mellitus
|
|
Morphine addiction
|
|
Nicotine addictionhsa04010:MAPK signaling pathway
|
|
cGMP-PKG signaling pathway
|
|
cAMP signaling pathway
|
|
Cardiac muscle contraction
|
|
Adrenergic signaling in cardiomyocytes
|
|
Vascular smooth muscle contraction
|
|
Circadian entrainment
|
|
Long-term potentiation
|
|
Glutamatergic synapse
|
|
Insulin secretion
|
|
GnRH signaling pathway
|
|
Oxytocin signaling pathway
|
|
Alzheimer's disease
|
|
Amphetamine addiction
|
|
Hypertrophic cardiomyopathy (HCM)
|
|
Arrhythmogenic right ventricular cardiomyopathy (ARVC)
|
|
Dilated cardiomyopathyhsa04725:Cholinergic synapsehsa04725:Cholinergic synapsehsa04010:MAPK signaling pathway
|
|
Carbohydrate digestion and absorption
|
|
Dilated cardiomyopathy
|
|
NetPath Pathway
|
IL2 Signaling Pathway
|
|
PANTHER Pathway
|
Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathway
|
|
Ionotropic glutamate receptor pathway
|
|
Metabotropic glutamate receptor group III pathway
|
|
Metabotropic glutamate receptor group II pathway
|
|
Thyrotropin-releasing hormone receptor signaling pathway
|
|
Endogenous cannabinoid signaling
|
|
GABA-B receptor II signalingP00003:Alzheimer disease-amyloid secretase pathway
|
|
Nicotinic acetylcholine receptor signaling pathway
|
|
5HT2 type receptor mediated signaling pathway
|
|
Beta1 adrenergic receptor signaling pathway
|
|
Beta2 adrenergic receptor signaling pathway
|
|
Oxytocin receptor mediated signaling pathway
|
|
Nicotine pharmacodynamics pathwayP00042:Muscarinic acetylcholine receptor 1 and 3 signaling pathwayP00003:Alzheimer disease-amyloid secretase pathway
|
|
PathWhiz Pathway
|
Muscle/Heart Contraction
|
|
Reactome
|
Depolarization of the Presynaptic Terminal Triggers the Opening of Calcium ChannelsR-HSA-400042:Adrenaline,noradrenaline inhibits insulin secretion
|
|
NCAM1 interactions
|
|
Regulation of insulin secretionR-HSA-1296072:Voltage gated Potassium channels
|
|
Interaction between L1 and AnkyrinsR-HSA-1296072:Voltage gated Potassium channels
|
|
Interaction between L1 and AnkyrinsR-HSA-400042:Adrenaline,noradrenaline inhibits insulin secretion
|
|
Regulation of insulin secretionR-HSA-445095:Interaction between L1 and Ankyrins
|
|
WikiPathways
|
Calcium Regulation in the Cardiac Cell
|
|
Synaptic Vesicle PathwayWP536:Calcium Regulation in the Cardiac Cell
|
|
Arrhythmogenic Right Ventricular Cardiomyopathy
|
|
Alzheimers Disease
|
|
NCAM signaling for neurite out-growth
|
|
Integration of energy metabolism
|
|
Nicotine Activity on Chromaffin CellsWP2669:Potassium Channels
|
|
L1CAM interactionsWP2669:Potassium Channels
|
|
L1CAM interactionsWP536:Calcium Regulation in the Cardiac Cell
|
| References |
| REF 1 | Bioorg Med Chem Lett. 1999 Aug 16;9(16):2447-52.Synthesis and biological activity of substituted bis-(4-hydroxyphenyl)methanes as N-type calcium channel blockers. |
|---|
