| Drug General Information |
| Drug ID |
D08UOX
|
| Former ID |
DNC008401
|
| Drug Name |
FALCARINDIOL
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C17H24O2
|
| Canonical SMILES |
CCCCCCCC=CC(C#CC#CC(C=C)O)O
|
| InChI |
1S/C17H24O2/c1-3-5-6-7-8-9-10-14-17(19)15-12-11-13-16(18)4-2/h4,10,14,16-19H,2-3,5-9H2,1H3/b14-10-/t16?,17-/m0/s1
|
| InChIKey |
QWCNQXNAFCBLLV-KJGFWLTQSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Mu-type opioid receptor |
Target Info |
Inhibitor |
[2]
|
|---|
| Dopamine D1 receptor |
Target Info |
Inhibitor |
[2]
|
| 5-hydroxytryptamine 7 receptor |
Target Info |
Inhibitor |
[1]
|
| Kappa-type opioid receptor |
Target Info |
Inhibitor |
[2]
|
| Delta-type opioid receptor |
Target Info |
Inhibitor |
[2]
|
|
KEGG Pathway
|
Neuroactive ligand-receptor interaction
|
|
Estrogen signaling pathway
|
|
Morphine addictionhsa04020:Calcium signaling pathway
|
|
cAMP signaling pathway
|
|
Gap junction
|
|
Dopaminergic synapse
|
|
Parkinson's disease
|
|
Cocaine addiction
|
|
Amphetamine addiction
|
|
Morphine addiction
|
|
Alcoholismhsa04014:Ras signaling pathway
|
|
Calcium signaling pathway
|
|
Serotonergic synapsehsa04080:Neuroactive ligand-receptor interactionhsa04022:cGMP-PKG signaling pathway
|
|
Sphingolipid signaling pathway
|
|
NetPath Pathway
|
TCR Signaling Pathway
|
|
PANTHER Pathway
|
Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathway
|
|
Enkephalin releaseP05912:Dopamine receptor mediated signaling pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Opioid prodynorphin pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Enkephalin release
|
|
Opioid proenkephalin pathway
|
|
Opioid proopiomelanocortin pathway
|
|
Pathway Interaction Database
|
IL4-mediated signaling events
|
|
PathWhiz Pathway
|
Dopamine Activation of Neurological Reward SystemPW000443:Excitatory Neural Signalling Through 5-HTR 7 and Serotonin
|
|
Reactome
|
Peptide ligand-binding receptors
|
|
G alpha (i) signalling eventsR-HSA-390651:Dopamine receptors
|
|
G alpha (s) signalling eventsR-HSA-390666:Serotonin receptors
|
|
G alpha (s) signalling eventsR-HSA-375276:Peptide ligand-binding receptors
|
|
G alpha (i) signalling eventsR-HSA-375276:Peptide ligand-binding receptors
|
|
G alpha (i) signalling events
|
|
WikiPathways
|
TCR Signaling Pathway
|
|
GPCRs, Class A Rhodopsin-like
|
|
Peptide GPCRs
|
|
Opioid Signalling
|
|
GPCR ligand binding
|
|
GPCR downstream signalingWP666:Hypothetical Network for Drug Addiction
|
|
Monoamine GPCRs
|
|
Genes and (Common) Pathways Underlying Drug Addiction
|
|
GPCR downstream signalingWP734:Serotonin Receptor 4/6/7 and NR3C Signaling
|
|
GPCR downstream signaling
|
|
GPCRs, OtherWP455:GPCRs, Class A Rhodopsin-like
|
|
GPCR downstream signalingWP455:GPCRs, Class A Rhodopsin-like
|
| References |
| REF 1 | J Nat Prod. 2006 Apr;69(4):536-41.Serotonergic activity-guided phytochemical investigation of the roots of Angelica sinensis. |
|---|
| REF 2 | Bioorg Med Chem. 2008 Mar 15;16(6):3218-23. Epub 2007 Dec 31.Novel coumarin glycoside and phenethyl vanillate from Notopterygium forbesii and their binding affinities for opioid and dopamine receptors. |
|---|
