| Drug General Information |
| Drug ID |
D0HH8I
|
| Former ID |
DNC004713
|
| Drug Name |
FISETIN
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C15H10O6
|
| InChI |
InChI=1S/C15H10O6/c16-8-2-3-9-12(6-8)21-15(14(20)13(9)19)7-1-4-10(17)11(18)5-7/h1-6,16-18,20H
|
| InChIKey |
XHEFDIBZLJXQHF-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
12227, 476876, 507096, 598776, 854619, 877431, 3133267, 7584531, 7887589, 8137407, 8616674, 10318997, 11108248, 11113262, 11113263, 11341731, 11361914, 11364090, 11366652, 11369214, 11372551, 11374538, 11377376, 11408257, 11446655, 11484855, 11487316, 11488976, 11491351, 11492884, 11495010, 11537677, 12015309, 14922300, 22389243, 26612353, 26680015, 26697264, 26749675, 26753766, 29204137, 39290396, 46393572, 47960466, 48035861, 48421823, 49833373, 49970085, 50123013, 52761154
|
| Target and Pathway |
| Target(s) |
Enoyl-ACP reductase |
Target Info |
Inhibitor |
[2]
|
|---|
| 3-oxoacyl-[acyl-carrier protein] reductase |
Target Info |
Inhibitor |
[2]
|
| Cell division protein kinase 6 |
Target Info |
Inhibitor |
[3]
|
| Fatty acid synthase |
Target Info |
Inhibitor |
[2]
|
| Beta-hydroxyacyl-acp dehydratase |
Target Info |
Inhibitor |
[2]
|
|
BioCyc Pathway
|
Fatty acid biosynthesis initiation
|
|
Fatty acid elongation -- saturated
|
|
Palmitate biosynthesis
|
|
KEGG Pathway
|
Cell cycle
|
|
p53 signaling pathway
|
|
PI3K-Akt signaling pathway
|
|
Hepatitis B
|
|
Measles
|
|
Pathways in cancer
|
|
Viral carcinogenesis
|
|
MicroRNAs in cancer
|
|
Pancreatic cancer
|
|
Glioma
|
|
Melanoma
|
|
Chronic myeloid leukemia
|
|
Small cell lung cancer
|
|
Non-small cell lung cancerhsa00061:Fatty acid biosynthesis
|
|
Metabolic pathways
|
|
Fatty acid metabolism
|
|
AMPK signaling pathway
|
|
Insulin signaling pathwaypfa00061:Fatty acid biosynthesis
|
|
Biotin metabolism
|
|
Metabolic pathways
|
|
Fatty acid metabolism
|
|
NetPath Pathway
|
TGF_beta_Receptor Signaling Pathway
|
|
Pathway Interaction Database
|
p73 transcription factor network
|
|
Coregulation of Androgen receptor activity
|
|
C-MYB transcription factor network
|
|
IL2 signaling events mediated by STAT5
|
|
Regulation of retinoblastoma proteinp73pathway:p73 transcription factor network
|
|
Validated transcriptional targets of deltaNp63 isoforms
|
|
PathWhiz Pathway
|
Fatty Acid Biosynthesis
|
|
Reactome
|
Oxidative Stress Induced Senescence
|
|
Senescence-Associated Secretory Phenotype (SASP)
|
|
Oncogene Induced Senescence
|
|
Cyclin D associated events in G1R-HSA-163765:ChREBP activates metabolic gene expression
|
|
Activation of gene expression by SREBF (SREBP)
|
|
Fatty Acyl-CoA Biosynthesis
|
|
WikiPathways
|
DNA Damage Response
|
|
G1 to S cell cycle control
|
|
Wnt Signaling Pathway Netpath
|
|
Retinoblastoma (RB) in Cancer
|
|
Signaling Pathways in Glioblastoma
|
|
Metastatic brain tumor
|
|
miR-targeted genes in muscle cell - TarBase
|
|
miR-targeted genes in lymphocytes - TarBase
|
|
miR-targeted genes in leukocytes - TarBase
|
|
miR-targeted genes in epithelium - TarBase
|
|
Mitotic G1-G1/S phases
|
|
Cell Cycle
|
|
miRNAs involved in DNA damage response
|
|
miRNA Regulation of DNA Damage ResponseWP357:Fatty Acid Biosynthesis
|
|
Nuclear Receptors Meta-Pathway
|
|
Liver X Receptor Pathway
|
|
Activation of Gene Expression by SREBP (SREBF)
|
|
SREBF and miR33 in cholesterol and lipid homeostasis
|
|
SREBP signalling
|
|
Metabolism of water-soluble vitamins and cofactors
|
|
Integration of energy metabolism
|
|
Fatty acid, triacylglycerol, and ketone body metabolism
|
|
AMPK Signaling
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 5182). |
|---|
| REF 2 | J Med Chem. 2006 Jun 1;49(11):3345-53.Inhibition of Plasmodium falciparum fatty acid biosynthesis: evaluation of FabG, FabZ, and FabI as drug targets for flavonoids. |
|---|
| REF 3 | J Med Chem. 2005 Feb 10;48(3):737-43.Crystal structure of a human cyclin-dependent kinase 6 complex with a flavonol inhibitor, fisetin. |
|---|
