| Drug General Information |
| Drug ID |
D0Q5PC
|
| Former ID |
DNC011875
|
| Drug Name |
PHENCYCLIDINE
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C17H25N
|
| InChI |
InChI=1S/C17H25N/c1-4-10-16(11-5-1)17(12-6-2-7-13-17)18-14-8-3-9-15-18/h1,4-5,10-11H,2-3,6-9,12-15H2
|
| InChIKey |
JTJMJGYZQZDUJJ-UHFFFAOYSA-N
|
| CAS Number |
CAS 77-10-1
|
| PubChem Compound ID |
|
| PubChem Substance ID |
9778, 834903, 841141, 5501449, 7885098, 7980287, 8154127, 10535449, 14749651, 29225444, 46394322, 46508889, 47217202, 47589403, 47960162, 48416405, 50016869, 53787096, 53787541, 57323466, 75325665, 103168867, 103915210, 104312147, 117358123, 124953686, 125332495, 128324845, 134349080, 134972150, 135331394, 137001267, 139012441, 152042164, 160644701, 160966681, 163229342, 164764207, 172656498, 175443921, 178101099, 179226011, 198957747, 223533765, 226426904, 241142333, 250075876, 252658643
|
| Target and Pathway |
| Target(s) |
NMDA receptor subunit NR1 |
Target Info |
Inhibitor |
[2]
|
|---|
| Glutamate [NMDA] receptor subunit epsilon 2 |
Target Info |
Inhibitor |
[2]
|
| Glutamate [NMDA] receptor subunit epsilon 1 |
Target Info |
Inhibitor |
[2]
|
|
KEGG Pathway
|
Ras signaling pathway
|
|
Rap1 signaling pathway
|
|
Calcium signaling pathway
|
|
cAMP signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
Circadian entrainment
|
|
Long-term potentiation
|
|
Glutamatergic synapse
|
|
Alzheimer's disease
|
|
Amyotrophic lateral sclerosis (ALS)
|
|
Huntington's disease
|
|
Cocaine addiction
|
|
Amphetamine addiction
|
|
Nicotine addiction
|
|
Alcoholismhsa04014:Ras signaling pathway
|
|
Dopaminergic synapse
|
|
Alcoholism
|
|
Systemic lupus erythematosushsa04014:Ras signaling pathway
|
|
Systemic lupus erythematosus
|
|
PANTHER Pathway
|
Huntington disease
|
|
Ionotropic glutamate receptor pathway
|
|
Metabotropic glutamate receptor group III pathway
|
|
Metabotropic glutamate receptor group I pathway
|
|
Muscarinic acetylcholine receptor 1 and 3 signaling pathwayP00029:Huntington disease
|
|
Muscarinic acetylcholine receptor 1 and 3 signaling pathway
|
|
Pathway Interaction Database
|
ErbB4 signaling events
|
|
Reelin signaling pathwayreelinpathway:Reelin signaling pathway
|
|
Reactome
|
EPHB-mediated forward signaling
|
|
Unblocking of NMDA receptor, glutamate binding and activation
|
|
CREB phosphorylation through the activation of CaMKII
|
|
Ras activation uopn Ca2+ infux through NMDA receptor
|
|
RAF/MAP kinase cascadeR-HSA-3928662:EPHB-mediated forward signaling
|
|
RAF/MAP kinase cascadeR-HSA-438066:Unblocking of NMDA receptor, glutamate binding and activation
|
|
RAF/MAP kinase cascade
|
|
WikiPathways
|
SIDS Susceptibility Pathways
|
|
Hypothetical Network for Drug Addiction
|
|
Neurotransmitter Receptor Binding And Downstream Transmission In The Postsynaptic Cell
|
|
Spinal Cord Injury
|
|
BDNF signaling pathway
|
|
Alzheimers DiseaseWP666:Hypothetical Network for Drug Addiction
|
|
BDNF signaling pathwayWP666:Hypothetical Network for Drug Addiction
|
|
Alzheimers Disease
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 4282). |
|---|
| REF 2 | J Med Chem. 1996 Nov 22;39(24):4844-52.Synthesis and biological activity of conformationally restricted analogs of milnacipran: (1S,2R)-1-phenyl-2-[(S)-1-aminopropyl]-N,N-diethylcyclopropanecarboxamide, an efficient noncompetitive N-methyl-D-aspartic acid receptor antagonist. |
|---|
