| Drug General Information |
| Drug ID |
D0Y7HG
|
| Former ID |
DNC003978
|
| Drug Name |
GALANGIN
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C15H10O5
|
| InChI |
InChI=1S/C15H10O5/c16-9-6-10(17)12-11(7-9)20-15(14(19)13(12)18)8-4-2-1-3-5-8/h1-7,16-17,19H
|
| InChIKey |
VCCRNZQBSJXYJD-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
12230, 477031, 598777, 933814, 4952176, 8141726, 8616675, 11113137, 14799261, 24857027, 26754241, 29204160, 39290398, 47291844, 47737220, 48483283, 49658622, 49970093, 50114336, 50470349, 53790873, 57358257, 57648294, 85172617, 85272545, 85295316, 85843082, 88783679, 92722294, 103274384, 103979745, 108219750, 113855481, 117615397, 124557872, 124812137, 124882830, 124882831, 125352901, 126618402, 126657872, 126662732, 129453737, 131318504, 134341183, 134978005, 135650295, 137007388, 142495655, 143437214
|
| Target and Pathway |
| Target(s) |
Adenosine A3 receptor |
Target Info |
Inhibitor |
[2]
|
|---|
| Cytochrome P450 1B1 |
Target Info |
Inhibitor |
[3]
|
| Adenosine A2a receptor |
Target Info |
Inhibitor |
[4]
|
|
BioCyc Pathway
|
Superpathway of tryptophan utilization
|
|
Superpathway of melatonin degradation
|
|
Melatonin degradation I
|
|
KEGG Pathway
|
Steroid hormone biosynthesis
|
|
Tryptophan metabolism
|
|
Metabolism of xenobiotics by cytochrome P450
|
|
Ovarian steroidogenesis
|
|
Chemical carcinogenesis
|
|
MicroRNAs in cancerhsa04015:Rap1 signaling pathway
|
|
Calcium signaling pathway
|
|
cAMP signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
Vascular smooth muscle contraction
|
|
Parkinson's disease
|
|
Alcoholism
|
|
NetPath Pathway
|
TSH Signaling Pathway
|
|
IL4 Signaling Pathway
|
|
TGF_beta_Receptor Signaling Pathway
|
|
Pathway Interaction Database
|
HIF-2-alpha transcription factor network
|
|
PathWhiz Pathway
|
Intracellular Signalling Through Adenosine Receptor A2a and Adenosine
|
|
Reactome
|
Adenosine P1 receptors
|
|
G alpha (i) signalling eventsR-HSA-211976:Endogenous sterolsR-HSA-187024:NGF-independant TRKA activation
|
|
G alpha (s) signalling events
|
|
Surfactant metabolism
|
|
WikiPathways
|
Nucleotide GPCRs
|
|
GPCRs, Class A Rhodopsin-like
|
|
GPCRs, OtherWP702:Metapathway biotransformation
|
|
Estrogen metabolism
|
|
Benzo(a)pyrene metabolism
|
|
Tamoxifen metabolism
|
|
Tryptophan metabolism
|
|
Oxidation by Cytochrome P450
|
|
Nuclear Receptors Meta-Pathway
|
|
Estrogen Receptor Pathway
|
|
Sulindac Metabolic Pathway
|
|
Arylhydrocarbon receptor (AhR) signaling pathway
|
|
miR-targeted genes in muscle cell - TarBase
|
|
miR-targeted genes in lymphocytes - TarBase
|
|
miR-targeted genes in epithelium - TarBase
|
|
miR-targeted genes in adipocytes - TarBase
|
|
Phase 1 - Functionalization of compoundsWP80:Nucleotide GPCRs
|
|
Monoamine Transport
|
|
NGF signalling via TRKA from the plasma membrane
|
|
GPCR ligand binding
|
|
GPCR downstream signaling
|
|
GPCRs, Other
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 410). |
|---|
| REF 2 | J Med Chem. 1996 Feb 2;39(3):781-8.Interactions of flavonoids and other phytochemicals with adenosine receptors. |
|---|
| REF 3 | Bioorg Med Chem. 2010 Sep 1;18(17):6310-5. Epub 2010 Jul 13.Selective inhibition of methoxyflavonoids on human CYP1B1 activity. |
|---|
| REF 4 | J Med Chem. 1997 Aug 1;40(16):2588-95.Mutagenesis reveals structure-activity parallels between human A2A adenosine receptors and biogenic amine G protein-coupled receptors. |
|---|
