| Drug General Information |
| Drug ID |
D06ROA
|
| Former ID |
DNC003994
|
| Drug Name |
UH-301
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C16H24FNO
|
| InChI |
InChI=1S/C16H24FNO/c1-3-9-18(10-4-2)12-5-6-13-14(11-12)16(19)8-7-15(13)17/h7-8,12,19H,3-6,9-11H2,1-2H3/t12-/m1/s1
|
| InChIKey |
FNKBVTBXFLSTPB-GFCCVEGCSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
24263012, 26544398, 36454990, 47291402, 50111277, 74585723, 103216716, 103925254, 124750353, 127872235, 135650952, 140448634, 162426236, 172649242, 198954361, 233328396
|
| Target and Pathway |
| Target(s) |
Alpha-1A adrenergic receptor |
Target Info |
Inhibitor |
[2]
|
|---|
| D(2) dopamine receptor |
Target Info |
Inhibitor |
[2]
|
| 5-hydroxytryptamine 1A receptor |
Target Info |
Inhibitor |
[2]
|
| Alpha-1D adrenergic receptor |
Target Info |
Inhibitor |
[2]
|
| Alpha-1B adrenergic receptor |
Target Info |
Inhibitor |
[2]
|
|
KEGG Pathway
|
Calcium signaling pathway
|
|
cGMP-PKG signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
AMPK signaling pathway
|
|
Adrenergic signaling in cardiomyocytes
|
|
Vascular smooth muscle contraction
|
|
Salivary secretionhsa04015:Rap1 signaling pathway
|
|
cAMP signaling pathway
|
|
Gap junction
|
|
Dopaminergic synapse
|
|
Parkinson's disease
|
|
Cocaine addiction
|
|
Alcoholismhsa04024:cAMP signaling pathway
|
|
Serotonergic synapsehsa04020:Calcium signaling pathway
|
|
Salivary secretionhsa04020:Calcium signaling pathway
|
|
Salivary secretion
|
|
NetPath Pathway
|
IL2 Signaling PathwayNetPath_14:IL2 Signaling Pathway
|
|
PANTHER Pathway
|
Alpha adrenergic receptor signaling pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathway
|
|
Dopamine receptor mediated signaling pathway
|
|
Nicotine pharmacodynamics pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
5HT1 type receptor mediated signaling pathwayP00002:Alpha adrenergic receptor signaling pathway
|
|
Pathway Interaction Database
|
LPA receptor mediated events
|
|
Reactome
|
Adrenoceptors
|
|
G alpha (q) signalling events
|
|
G alpha (12/13) signalling eventsR-HSA-390651:Dopamine receptors
|
|
G alpha (i) signalling eventsR-HSA-390666:Serotonin receptors
|
|
G alpha (i) signalling eventsR-HSA-390696:Adrenoceptors
|
|
G alpha (12/13) signalling eventsR-HSA-390696:Adrenoceptors
|
|
G alpha (12/13) signalling events
|
|
WikiPathways
|
Monoamine GPCRs
|
|
Calcium Regulation in the Cardiac Cell
|
|
GPCRs, Class A Rhodopsin-like
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
Endothelin Pathways
|
|
GPCR ligand binding
|
|
GPCR downstream signaling
|
|
AMPK SignalingWP666:Hypothetical Network for Drug Addiction
|
|
Genes and (Common) Pathways Underlying Drug Addiction
|
|
Nicotine Activity on Dopaminergic NeuronsWP722:Serotonin HTR1 Group and FOS Pathway
|
|
SIDS Susceptibility Pathways
|
|
GPCR downstream signalingWP58:Monoamine GPCRs
|
|
GPCRs, OtherWP58:Monoamine GPCRs
|
|
Vitamin D Receptor Pathway
|
|
AMPK Signaling
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 3218). |
|---|
| REF 2 | J Med Chem. 1997 Apr 11;40(8):1252-7.N-[2-[(substituted chroman-8-yl)oxy]ethyl]-4-(4-methoxyphenyl)butylamines: synthesis and wide range of antagonism at the human 5-HT1A receptor. |
|---|
