| Drug General Information |
| Drug ID |
D0W9VA
|
| Former ID |
DNC003523
|
| Drug Name |
1,2-NAPHTHOQUINONE
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C10H6O2
|
| Canonical SMILES |
C1=CC=C2C(=C1)C=CC(=O)C2=O
|
| InChI |
1S/C10H6O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6H
|
| InChIKey |
KETQAJRQOHHATG-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Acetylcholinesterase |
Target Info |
Inhibitor |
[1]
|
|---|
| Indoleamine 2,3-dioxygenase |
Target Info |
Inhibitor |
[2]
|
| Liver carboxylesterase |
Target Info |
Inhibitor |
[1]
|
| mRNA of Protein tyrosine phosphatase-1B |
Target Info |
Inhibitor |
[3]
|
| Cholinesterase |
Target Info |
Inhibitor |
[1]
|
|
BioCyc Pathway
|
Superpathway of tryptophan utilization
|
|
Tryptophan degradation
|
|
L-kynurenine degradation
|
|
Tryptophan degradation to 2-amino-3-carboxymuconate semialdehyde
|
|
NAD de novo biosynthesis
|
|
KEGG Pathway
|
Glycerophospholipid metabolism
|
|
Cholinergic synapsehsa00380:Tryptophan metabolism
|
|
Metabolic pathways
|
|
African trypanosomiasishsa00983:Drug metabolism - other enzymes
|
|
Metabolic pathwayshsa04520:Adherens junction
|
|
Insulin signaling pathway
|
|
NetPath Pathway
|
TSLP Signaling Pathway
|
|
IL5 Signaling Pathway
|
|
TGF_beta_Receptor Signaling PathwayNetPath_25:FSH Signaling Pathway
|
|
PANTHER Pathway
|
Muscarinic acetylcholine receptor 1 and 3 signaling pathway
|
|
Muscarinic acetylcholine receptor 2 and 4 signaling pathway
|
|
Nicotinic acetylcholine receptor signaling pathwayP00012:Cadherin signaling pathwayP00042:Muscarinic acetylcholine receptor 1 and 3 signaling pathway
|
|
Nicotinic acetylcholine receptor signaling pathway
|
|
Pathway Interaction Database
|
ATF-2 transcription factor networke2f_pathway:E2F transcription factor networkinsulin_pathway:Insulin Pathway
|
|
Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met)
|
|
Signaling events mediated by PTP1B
|
|
Calcineurin-regulated NFAT-dependent transcription in lymphocytes
|
|
Signaling events mediated by TCPTP
|
|
IGF1 pathway
|
|
EGF receptor (ErbB1) signaling pathway
|
|
Posttranslational regulation of adherens junction stability and dissassembly
|
|
PDGFR-beta signaling pathway
|
|
N-cadherin signaling events
|
|
PathWhiz Pathway
|
Phospholipid BiosynthesisPW000163:Tryptophan Metabolism
|
|
Reactome
|
Tryptophan catabolismR-HSA-354192:Integrin alphaIIb beta3 signaling
|
|
Regulation of IFNG signaling
|
|
Regulation of IFNA signaling
|
|
Growth hormone receptor signaling
|
|
WikiPathways
|
Monoamine Transport
|
|
Biogenic Amine Synthesis
|
|
Acetylcholine Synthesis
|
|
Integrated Pancreatic Cancer PathwayWP465:Tryptophan metabolism
|
|
Metabolism of amino acids and derivativesWP2884:NRF2 pathway
|
|
Nuclear Receptors Meta-Pathway
|
|
Heroin metabolism
|
|
Irinotecan Pathway
|
|
Fluoropyrimidine Activity
|
|
Phase I biotransformations, non P450WP481:Insulin Signaling
|
|
Growth hormone receptor signaling
|
|
Leptin signaling pathway
|
|
Interferon gamma signaling
|
|
Interferon alpha/beta signaling
|
|
Integrin alphaIIb beta3 signalingWP229:Irinotecan Pathway
|
| References |
| REF 1 | J Med Chem. 2007 Nov 15;50(23):5727-34. Epub 2007 Oct 17.Planarity and constraint of the carbonyl groups in 1,2-diones are determinants for selective inhibition of human carboxylesterase 1. |
|---|
| REF 2 | J Med Chem. 2008 Mar 27;51(6):1706-18. Epub 2008 Mar 5.Indoleamine 2,3-dioxygenase is the anticancer target for a novel series of potent naphthoquinone-based inhibitors. |
|---|
| REF 3 | Bioorg Med Chem Lett. 2002 Aug 5;12(15):1941-6.Synthesis and PTP1B inhibition of 1,2-naphthoquinone derivatives as potent anti-diabetic agents. |
|---|
