| Drug General Information |
| Drug ID |
D0HV3A
|
| Former ID |
DNC011857
|
| Drug Name |
FLUMEZAPINE
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C17H19FN4S
|
| Canonical SMILES |
CC1=CC2=C(NC3=C(C=CC(=C3)F)N=C2S1)N4CCN(CC4)C
|
| InChI |
1S/C17H19FN4S/c1-11-9-13-16(22-7-5-21(2)6-8-22)19-15-10-12(18)3-4-14(15)20-17(13)23-11/h3-4,9-10,19H,5-8H2,1-2H3
|
| InChIKey |
CABBDKQGQDDPQA-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
D(4) dopamine receptor |
Target Info |
Inhibitor |
[2]
|
|---|
| D(2) dopamine receptor |
Target Info |
Inhibitor |
[1]
|
| Dopamine D1 receptor |
Target Info |
Inhibitor |
[2]
|
| Muscarinic acetylcholine receptor M4 |
Target Info |
Inhibitor |
[1]
|
| Muscarinic acetylcholine receptor M5 |
Target Info |
Inhibitor |
[1]
|
| Muscarinic acetylcholine receptor M2 |
Target Info |
Inhibitor |
[1]
|
| Muscarinic acetylcholine receptor M1 |
Target Info |
Inhibitor |
[1]
|
| Muscarinic acetylcholine receptor M3 |
Target Info |
Inhibitor |
[1]
|
| D(3) dopamine receptor |
Target Info |
Inhibitor |
[2]
|
| D(1B) dopamine receptor |
Target Info |
Inhibitor |
[2]
|
|
KEGG Pathway
|
Neuroactive ligand-receptor interaction
|
|
Dopaminergic synapsehsa04015:Rap1 signaling pathway
|
|
cAMP signaling pathway
|
|
Gap junction
|
|
Dopaminergic synapse
|
|
Parkinson's disease
|
|
Cocaine addiction
|
|
Alcoholismhsa04020:Calcium signaling pathway
|
|
Amphetamine addiction
|
|
Morphine addiction
|
|
Alcoholismhsa04080:Neuroactive ligand-receptor interaction
|
|
Cholinergic synapse
|
|
Regulation of actin cytoskeletonhsa04020:Calcium signaling pathway
|
|
PI3K-Akt signaling pathway
|
|
Regulation of actin cytoskeleton
|
|
Insulin secretion
|
|
Salivary secretion
|
|
Gastric acid secretion
|
|
Pancreatic secretionhsa04080:Neuroactive ligand-receptor interaction
|
|
Dopaminergic synapsehsa04020:Calcium signaling pathway
|
|
PANTHER Pathway
|
Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathway
|
|
Dopamine receptor mediated signaling pathway
|
|
Nicotine pharmacodynamics pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Nicotine pharmacodynamics pathwayP05912:Dopamine receptor mediated signaling pathwayP00003:Alzheimer disease-amyloid secretase pathway
|
|
Muscarinic acetylcholine receptor 2 and 4 signaling pathwayP00003:Alzheimer disease-amyloid secretase pathway
|
|
Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathwayP00003:Alzheimer disease-amyloid secretase pathway
|
|
Muscarinic acetylcholine receptor 1 and 3 signaling pathwayP00003:Alzheimer disease-amyloid secretase pathway
|
|
Muscarinic acetylcholine receptor 1 and 3 signaling pathwayP05912:Dopamine receptor mediated signaling pathway
|
|
PathWhiz Pathway
|
Dopamine Activation of Neurological Reward SystemPW000564:Muscle/Heart ContractionPW000565:Gastric Acid Production
|
|
Reactome
|
Dopamine receptors
|
|
G alpha (i) signalling eventsR-HSA-390651:Dopamine receptors
|
|
G alpha (s) signalling eventsR-HSA-390648:Muscarinic acetylcholine receptors
|
|
G alpha (i) signalling eventsR-HSA-390648:Muscarinic acetylcholine receptors
|
|
G alpha (q) signalling eventsR-HSA-390648:Muscarinic acetylcholine receptors
|
|
Acetylcholine regulates insulin secretion
|
|
G alpha (q) signalling eventsR-HSA-390651:Dopamine receptors
|
|
G alpha (s) signalling events
|
|
WikiPathways
|
Hypothetical Network for Drug Addiction
|
|
Monoamine GPCRs
|
|
GPCRs, Class A Rhodopsin-like
|
|
Genes and (Common) Pathways Underlying Drug Addiction
|
|
GPCR ligand binding
|
|
GPCR downstream signaling
|
|
Nicotine Activity on Dopaminergic Neurons
|
|
GPCRs, OtherWP666:Hypothetical Network for Drug Addiction
|
|
Nicotine Activity on Dopaminergic NeuronsWP666:Hypothetical Network for Drug Addiction
|
|
GPCR downstream signalingWP58:Monoamine GPCRs
|
|
Calcium Regulation in the Cardiac Cell
|
|
Regulation of Actin Cytoskeleton
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
GPCR downstream signalingWP706:SIDS Susceptibility Pathways
|
|
GPCRs, OtherWP58:Monoamine GPCRs
|
|
Secretion of Hydrochloric Acid in Parietal Cells
|
|
Integration of energy metabolism
|
| References |
| REF 1 | J Med Chem. 1989 Dec;32(12):2573-82.Synthesis and pharmacological evaluation of a series of 4-piperazinylpyrazolo[3,4-b]- and -[4,3-b][1,5]benzodiazepines as potential anxiolytics. |
|---|
| REF 2 | J Med Chem. 1982 Oct;25(10):1133-40.Effects of conformationally restricted 4-piperazinyl-10H-thienobenzodiazepine neuroleptics on central dopaminergic and cholinergic systems. |
|---|
