| Drug General Information |
| Drug ID |
D0T2RY
|
| Former ID |
DNC011171
|
| Drug Name |
4-(4-butylpiperidin-1-yl)-1-o-tolylbutan-1-one
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C20H31NO
|
| Canonical SMILES |
CCCCC1CCN(CC1)CCCC(=O)C2=CC=CC=C2C
|
| InChI |
1S/C20H31NO/c1-3-4-9-18-12-15-21(16-13-18)14-7-11-20(22)19-10-6-5-8-17(19)2/h5-6,8,10,18H,3-4,7,9,11-16H2,1-2H3
|
| InChIKey |
ANTKBACNWQHQJE-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Mu-type opioid receptor |
Target Info |
Inhibitor |
[1]
|
|---|
| Histamine H3 receptor |
Target Info |
Inhibitor |
[1]
|
| Muscarinic acetylcholine receptor M3 |
Target Info |
Inhibitor |
[1]
|
| D(3) dopamine receptor |
Target Info |
Inhibitor |
[1]
|
| Acetylcholinesterase |
Target Info |
Inhibitor |
[1]
|
| Neurotensin receptor type 1 |
Target Info |
Inhibitor |
[1]
|
| Melanocortin-4 receptor |
Target Info |
Inhibitor |
[1]
|
| Neuronal acetylcholine receptor protein, alpha-4 chain |
Target Info |
Inhibitor |
[1]
|
| 5-hydroxytryptamine receptor 3A |
Target Info |
Inhibitor |
[1]
|
| 5-hydroxytryptamine 2B receptor |
Target Info |
Inhibitor |
[1]
|
| Sodium-dependent serotonin transporter |
Target Info |
Inhibitor |
[1]
|
| Alpha-1A adrenergic receptor |
Target Info |
Inhibitor |
[1]
|
| Endothelin-1 receptor |
Target Info |
Inhibitor |
[1]
|
| Muscarinic acetylcholine receptor M1 |
Target Info |
Inhibitor |
[1]
|
| Histamine H1 receptor |
Target Info |
Inhibitor |
[1]
|
| Muscarinic acetylcholine receptor M2 |
Target Info |
Inhibitor |
[1]
|
| Adenosine A1 receptor |
Target Info |
Inhibitor |
[1]
|
| 5-hydroxytryptamine 4 receptor |
Target Info |
Inhibitor |
[1]
|
| Histamine H2 receptor |
Target Info |
Inhibitor |
[1]
|
| Sodium-dependent dopamine transporter |
Target Info |
Inhibitor |
[1]
|
| Muscarinic acetylcholine receptor M5 |
Target Info |
Inhibitor |
[1]
|
| Cannabinoid receptor 1 |
Target Info |
Inhibitor |
[1]
|
| Alpha-1D adrenergic receptor |
Target Info |
Inhibitor |
[1]
|
| Dopamine D1 receptor |
Target Info |
Inhibitor |
[1]
|
| Muscarinic acetylcholine receptor M4 |
Target Info |
Inhibitor |
[1]
|
| 5-hydroxytryptamine 2A receptor |
Target Info |
Inhibitor |
[1]
|
| 5-hydroxytryptamine 1A receptor |
Target Info |
Inhibitor |
[1]
|
| Gastrin/cholecystokinin type B receptor |
Target Info |
Inhibitor |
[1]
|
| Adenosine A3 receptor |
Target Info |
Inhibitor |
[1]
|
| 5-hydroxytryptamine 7 receptor |
Target Info |
Inhibitor |
[1]
|
| Melatonin receptor |
Target Info |
Inhibitor |
[1]
|
| D(2) dopamine receptor |
Target Info |
Inhibitor |
[1]
|
| Alpha-2A adrenergic receptor |
Target Info |
Inhibitor |
[1]
|
| Neuropeptide Y receptor type 1 |
Target Info |
Inhibitor |
[1]
|
| 5-hydroxytryptamine 2C receptor |
Target Info |
Inhibitor |
[1]
|
| Beta-1 adrenergic receptor |
Target Info |
Inhibitor |
[1]
|
| Neuronal acetylcholine receptor protein, beta-2 chain |
Target Info |
Inhibitor |
[1]
|
| NK-2 receptor |
Target Info |
Inhibitor |
[1]
|
| Alpha-1B adrenergic receptor |
Target Info |
Inhibitor |
[1]
|
| Substance-P receptor |
Target Info |
Inhibitor |
[1]
|
| Adenosine A2a receptor |
Target Info |
Inhibitor |
[1]
|
| Sodium-dependent noradrenaline transporter |
Target Info |
Inhibitor |
[1]
|
| mRNA of glucocorticoid receptor |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
Neuroactive ligand-receptor interaction
|
|
Estrogen signaling pathway
|
|
Morphine addictionhsa04080:Neuroactive ligand-receptor interactionhsa04020:Calcium signaling pathway
|
|
Cholinergic synapse
|
|
Regulation of actin cytoskeleton
|
|
Insulin secretion
|
|
Salivary secretion
|
|
Gastric acid secretion
|
|
Pancreatic secretionhsa04080:Neuroactive ligand-receptor interaction
|
|
Dopaminergic synapsehsa00564:Glycerophospholipid metabolism
|
|
Cholinergic synapsehsa04020:Calcium signaling pathway
|
|
Neuroactive ligand-receptor interactionhsa04080:Neuroactive ligand-receptor interactionhsa04080:Neuroactive ligand-receptor interaction
|
|
Nicotine addictionhsa04726:Serotonergic synapsehsa04020:Calcium signaling pathway
|
|
Gap junction
|
|
Serotonergic synapse
|
|
Inflammatory mediator regulation of TRP channelshsa04726:Serotonergic synapsehsa04020:Calcium signaling pathway
|
|
cGMP-PKG signaling pathway
|
|
AMPK signaling pathway
|
|
Adrenergic signaling in cardiomyocytes
|
|
Vascular smooth muscle contraction
|
|
Salivary secretionhsa04020:Calcium signaling pathway
|
|
cAMP signaling pathway
|
|
Renin secretion
|
|
Pathways in cancerhsa04020:Calcium signaling pathway
|
|
PI3K-Akt signaling pathway
|
|
Regulation of actin cytoskeletonhsa04020:Calcium signaling pathway
|
|
Inflammatory mediator regulation of TRP channelshsa04020:Calcium signaling pathway
|
|
Regulation of actin cytoskeletonhsa04022:cGMP-PKG signaling pathway
|
|
Sphingolipid signaling pathway
|
|
Morphine addictionhsa04020:Calcium signaling pathway
|
|
Serotonergic synapsehsa04020:Calcium signaling pathway
|
|
Gastric acid secretionhsa04728:Dopaminergic synapse
|
|
Parkinson's disease
|
|
Cocaine addiction
|
|
Amphetamine addiction
|
|
Alcoholismhsa04020:Calcium signaling pathway
|
|
Regulation of actin cytoskeletonhsa04015:Rap1 signaling pathway
|
|
Retrograde endocannabinoid signalinghsa04020:Calcium signaling pathway
|
|
Dopaminergic synapse
|
|
Morphine addiction
|
|
Alcoholismhsa04080:Neuroactive ligand-receptor interaction
|
|
Inflammatory mediator regulation of TRP channelshsa04024:cAMP signaling pathway
|
|
Gastric acid secretionhsa04014:Ras signaling pathway
|
|
Calcium signaling pathway
|
|
Serotonergic synapsehsa04080:Neuroactive ligand-receptor interaction
|
|
Circadian entrainmenthsa04015:Rap1 signaling pathway
|
|
Alcoholismhsa04022:cGMP-PKG signaling pathway
|
|
Neuroactive ligand-receptor interactionhsa04024:cAMP signaling pathway
|
|
Neuroactive ligand-receptor interactionhsa04020:Calcium signaling pathway
|
|
Endocytosis
|
|
Dilated cardiomyopathyhsa04080:Neuroactive ligand-receptor interaction
|
|
Nicotine addictionhsa04020:Calcium signaling pathway
|
|
Measleshsa04015:Rap1 signaling pathway
|
|
NetPath Pathway
|
TCR Signaling PathwayNetPath_14:IL2 Signaling PathwayNetPath_11:TCR Signaling PathwayNetPath_16:IL4 Signaling PathwayNetPath_11:TCR Signaling Pathway
|
|
RANKL Signaling PathwayNetPath_14:IL2 Signaling PathwayNetPath_25:FSH Signaling PathwayNetPath_14:IL2 Signaling PathwayNetPath_14:IL2 Signaling Pathway
|
|
TCR Signaling Pathway
|
|
PANTHER Pathway
|
Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathway
|
|
Enkephalin releaseP00003:Alzheimer disease-amyloid secretase pathway
|
|
Muscarinic acetylcholine receptor 1 and 3 signaling pathwayP00042:Muscarinic acetylcholine receptor 1 and 3 signaling pathway
|
|
Muscarinic acetylcholine receptor 2 and 4 signaling pathway
|
|
Nicotinic acetylcholine receptor signaling pathwayP00044:Nicotinic acetylcholine receptor signaling pathway
|
|
Nicotine pharmacodynamics pathwayP04375:5HT3 type receptor mediated signaling pathwayP04374:5HT2 type receptor mediated signaling pathwayP04373:5HT1 type receptor mediated signaling pathway
|
|
5HT2 type receptor mediated signaling pathway
|
|
5HT3 type receptor mediated signaling pathway
|
|
5HT4 type receptor mediated signaling pathwayP00002:Alpha adrenergic receptor signaling pathwayP00019:Endothelin signaling pathwayP00003:Alzheimer disease-amyloid secretase pathway
|
|
Muscarinic acetylcholine receptor 1 and 3 signaling pathwayP04385:Histamine H1 receptor mediated signaling pathwayP00003:Alzheimer disease-amyloid secretase pathway
|
|
Muscarinic acetylcholine receptor 2 and 4 signaling pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
5HT4 type receptor mediated signaling pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Histamine H2 receptor mediated signaling pathwayP00001:Adrenaline and noradrenaline biosynthesis
|
|
Parkinson disease
|
|
Dopamine receptor mediated signaling pathwayP00003:Alzheimer disease-amyloid secretase pathway
|
|
Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathwayP05730:Endogenous cannabinoid signalingP05912:Dopamine receptor mediated signaling pathwayP00003:Alzheimer disease-amyloid secretase pathway
|
|
Muscarinic acetylcholine receptor 2 and 4 signaling pathwayP04374:5HT2 type receptor mediated signaling pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
5HT1 type receptor mediated signaling pathwayP06959:CCKR signaling map STP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Dopamine receptor mediated signaling pathway
|
|
Nicotine pharmacodynamics pathwayP00002:Alpha adrenergic receptor signaling pathwayP04374:5HT2 type receptor mediated signaling pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Beta1 adrenergic receptor signaling pathwayP00044:Nicotinic acetylcholine receptor signaling pathway
|
|
Nicotine pharmacodynamics pathwayP00002:Alpha adrenergic receptor signaling pathwayP06959:CCKR signaling map STP00001:Adrenaline and noradrenaline biosynthesis
|
|
Pathway Interaction Database
|
IL4-mediated signaling eventsatf2_pathway:ATF-2 transcription factor networksyndecan_3_pathway:Syndecan-3-mediated signaling eventsendothelinpathway:Endothelins
|
|
EGFR-dependent Endothelin signaling eventsalphasynuclein_pathway:Alpha-synuclein signalingncadherinpathway:N-cadherin signaling eventslysophospholipid_pathway:LPA receptor mediated eventshif2pathway:HIF-2-alpha transcription factor networksmad2_3nuclearpathway:Regulation of nuclear SMAD2/3 signaling
|
|
Signaling events mediated by HDAC Class II
|
|
FOXA2 and FOXA3 transcription factor networks
|
|
Glucocorticoid receptor regulatory network
|
|
Regulation of Androgen receptor activity
|
|
AP-1 transcription factor network
|
|
PathWhiz Pathway
|
Gastric Acid ProductionPW000048:Phospholipid BiosynthesisPW000564:Muscle/Heart ContractionPW000441:Excitatory Neural Signalling Through 5-HTR 4 and SerotoninPW000449:Intracellular Signalling Through Histamine H2 Receptor and Histamine
|
|
Gastric Acid ProductionPW000440:Dopamine Activation of Neurological Reward SystemPW000565:Gastric Acid ProductionPW000443:Excitatory Neural Signalling Through 5-HTR 7 and SerotoninPW000564:Muscle/Heart ContractionPW000445:Intracellular Signalling Through Adenosine Receptor A2a and Adenosine
|
|
Reactome
|
Peptide ligand-binding receptors
|
|
G alpha (i) signalling eventsR-HSA-390650:Histamine receptors
|
|
G alpha (i) signalling eventsR-HSA-390648:Muscarinic acetylcholine receptors
|
|
Acetylcholine regulates insulin secretion
|
|
G alpha (q) signalling eventsR-HSA-390651:Dopamine receptors
|
|
G alpha (i) signalling eventsR-HSA-375276:Peptide ligand-binding receptors
|
|
G alpha (q) signalling eventsR-HSA-375276:Peptide ligand-binding receptors
|
|
G alpha (s) signalling eventsR-HSA-629587:Highly sodium permeable acetylcholine nicotinic receptors
|
|
Highly calcium permeable postsynaptic nicotinic acetylcholine receptors
|
|
Highly calcium permeable nicotinic acetylcholine receptorsR-HSA-975298:Ligand-gated ion channel transportR-HSA-390666:Serotonin receptors
|
|
G alpha (q) signalling eventsR-HSA-390696:Adrenoceptors
|
|
G alpha (q) signalling events
|
|
G alpha (12/13) signalling eventsR-HSA-375276:Peptide ligand-binding receptors
|
|
G alpha (q) signalling eventsR-HSA-390648:Muscarinic acetylcholine receptors
|
|
G alpha (q) signalling eventsR-HSA-390650:Histamine receptors
|
|
G alpha (i) signalling eventsR-HSA-417973:Adenosine P1 receptors
|
|
G alpha (i) signalling eventsR-HSA-390666:Serotonin receptors
|
|
G alpha (s) signalling eventsR-HSA-390650:Histamine receptors
|
|
G alpha (s) signalling eventsR-HSA-442660:Na+/Cl- dependent neurotransmitter transportersR-HSA-390648:Muscarinic acetylcholine receptors
|
|
G alpha (q) signalling eventsR-HSA-373076:Class A/1 (Rhodopsin-like receptors)
|
|
G alpha (i) signalling eventsR-HSA-390696:Adrenoceptors
|
|
G alpha (12/13) signalling eventsR-HSA-390651:Dopamine receptors
|
|
G alpha (s) signalling eventsR-HSA-390648:Muscarinic acetylcholine receptors
|
|
G alpha (q) signalling eventsR-HSA-390666:Serotonin receptors
|
|
Gastrin-CREB signalling pathway via PKC and MAPKR-HSA-417973:Adenosine P1 receptors
|
|
G alpha (s) signalling eventsR-HSA-373076:Class A/1 (Rhodopsin-like receptors)
|
|
G alpha (i) signalling eventsR-HSA-390651:Dopamine receptors
|
|
Adrenaline signalling through Alpha-2 adrenergic receptor
|
|
Adrenaline,noradrenaline inhibits insulin secretion
|
|
G alpha (i) signalling events
|
|
G alpha (z) signalling events
|
|
Surfactant metabolismR-HSA-375276:Peptide ligand-binding receptors
|
|
Highly calcium permeable nicotinic acetylcholine receptorsR-HSA-416476:G alpha (q) signalling eventsR-HSA-390696:Adrenoceptors
|
|
G alpha (12/13) signalling eventsR-HSA-416476:G alpha (q) signalling eventsR-HSA-187024:NGF-independant TRKA activation
|
|
Adenosine P1 receptors
|
|
G alpha (s) signalling events
|
|
Surfactant metabolismR-HSA-442660:Na+/Cl- dependent neurotransmitter transportersR-HSA-1368108:BMAL1:CLOCK,NPAS2 activates circadian gene expression
|
|
WikiPathways
|
TCR Signaling Pathway
|
|
GPCRs, Class A Rhodopsin-like
|
|
Peptide GPCRs
|
|
Opioid Signalling
|
|
GPCR ligand binding
|
|
GPCR downstream signalingWP727:Monoamine Transport
|
|
GPCR downstream signalingWP58:Monoamine GPCRs
|
|
Calcium Regulation in the Cardiac Cell
|
|
Regulation of Actin Cytoskeleton
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
Integration of energy metabolism
|
|
GPCR downstream signaling
|
|
GPCRs, OtherWP58:Monoamine GPCRs
|
|
Nicotine Activity on Dopaminergic Neurons
|
|
GPCRs, OtherWP727:Monoamine Transport
|
|
Biogenic Amine Synthesis
|
|
Acetylcholine Synthesis
|
|
Integrated Pancreatic Cancer PathwayWP455:GPCRs, Class A Rhodopsin-like
|
|
GPCRs, OtherWP455:GPCRs, Class A Rhodopsin-like
|
|
GPCR downstream signalingWP706:SIDS Susceptibility Pathways
|
|
Neurotransmitter Receptor Binding And Downstream Transmission In The Postsynaptic Cell
|
|
Nicotine Activity on Dopaminergic NeuronsWP706:SIDS Susceptibility Pathways
|
|
Iron uptake and transportWP732:Serotonin Receptor 2 and ELK-SRF/GATA4 signaling
|
|
Monoamine GPCRs
|
|
SIDS Susceptibility Pathways
|
|
NRF2 pathway
|
|
Synaptic Vesicle Pathway
|
|
Serotonin Transporter ActivityWP58:Monoamine GPCRs
|
|
Endothelin Pathways
|
|
AMPK SignalingWP98:Prostaglandin Synthesis and Regulation
|
|
Secretion of Hydrochloric Acid in Parietal Cells
|
|
IL-4 Signaling Pathway
|
|
GPCRs, OtherWP80:Nucleotide GPCRs
|
|
GPCR downstream signalingWP734:Serotonin Receptor 4/6/7 and NR3C Signaling
|
|
Dopaminergic Neurogenesis
|
|
Parkinsons Disease Pathway
|
|
Transport of glucose and other sugars, bile salts and organic acids, metal ions and amine compounds
|
|
Neurotransmitter Clearance In The Synaptic CleftWP58:Monoamine GPCRs
|
|
GPCR downstream signalingWP455:GPCRs, Class A Rhodopsin-like
|
|
Small Ligand GPCRs
|
|
BDNF signaling pathway
|
|
GPCRs, OtherWP666:Hypothetical Network for Drug Addiction
|
|
Genes and (Common) Pathways Underlying Drug Addiction
|
|
GPCR downstream signalingWP733:Serotonin Receptor 2 and STAT3 Signaling
|
|
Serotonin Receptor 2 and ELK-SRF/GATA4 signaling
|
|
GPCRs, OtherWP722:Serotonin HTR1 Group and FOS Pathway
|
|
GPCRs, OtherWP734:Serotonin Receptor 4/6/7 and NR3C Signaling
|
|
GPCR downstream signalingWP666:Hypothetical Network for Drug Addiction
|
|
Nicotine Activity on Dopaminergic NeuronsWP58:Monoamine GPCRs
|
|
Platelet Aggregation (Plug Formation)
|
|
GPCR downstream signalingWP732:Serotonin Receptor 2 and ELK-SRF/GATA4 signaling
|
|
Nicotine Activity on Dopaminergic NeuronsWP2664:Gastrin-CREB signalling pathway via PKC and MAPK
|
|
Vitamin D Receptor Pathway
|
|
AMPK SignalingWP706:SIDS Susceptibility Pathways
|
|
Spinal Cord Injury
|
|
GPCR downstream signalingWP80:Nucleotide GPCRs
|
|
Monoamine Transport
|
|
NGF signalling via TRKA from the plasma membrane
|
|
Transport of glucose and other sugars, bile salts and organic acids, metal ions and amine compoundsWP734:Serotonin Receptor 4/6/7 and NR3C Signaling
|
|
Endoderm Differentiation
|
|
Hair Follicle Development: Cytodifferentiation (Part 3 of 3)
|
|
Adipogenesis
|
|
Circadian Clock
|
|
Nuclear Receptors
|
| References |
| REF 1 | J Med Chem. 2010 Sep 9;53(17):6386-97.Discovery of N-{1-[3-(3-oxo-2,3-dihydrobenzo[1,4]oxazin-4-yl)propyl]piperidin-4-yl}-2-phenylacetamide (Lu AE51090): an allosteric muscarinic M1 receptor agonist with unprecedented selectivity and procognitive potential. |
|---|
